About 4-[tert-butyl(dimethyl)silyl]oxy-3,3-difluorobutan-2-ol
4-[tert-butyl(dimethyl)silyl]oxy-3,3-difluorobutan-2-ol (PubChem CID 157193869) has the molecular formula C10H22F2O2Si
and a molecular weight of 240.37 g/mol. Its IUPAC name is 4-[tert-butyl(dimethyl)silyl]oxy-3,3-difluorobutan-2-ol.
Molecular Properties
| Compound Name | 4-[tert-butyl(dimethyl)silyl]oxy-3,3-difluorobutan-2-ol |
| PubChem CID | 157193869 |
| Molecular Formula | C10H22F2O2Si |
| Molecular Weight | 240.37 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | 4-[tert-butyl(dimethyl)silyl]oxy-3,3-difluorobutan-2-ol |
| SMILES | CC(O)C(F)(F)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C10H22F2O2Si/c1-8(13)10(11,12)7-14-15(5,6)9(2,3)4/h8,13H,7H2,1-6H3 |
| InChIKey | WQFVUFGYZDXSDD-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.37 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 4-[tert-butyl(dimethyl)silyl]oxy-3,3-difluorobutan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[tert-butyl(dimethyl)silyl]oxy-3,3-difluorobutan-2-ol?
The IUPAC name of 4-[tert-butyl(dimethyl)silyl]oxy-3,3-difluorobutan-2-ol (CID 157193869) is 4-[tert-butyl(dimethyl)silyl]oxy-3,3-difluorobutan-2-ol.
What is the SMILES notation for 4-[tert-butyl(dimethyl)silyl]oxy-3,3-difluorobutan-2-ol?
The canonical SMILES for 4-[tert-butyl(dimethyl)silyl]oxy-3,3-difluorobutan-2-ol is CC(O)C(F)(F)CO[Si](C)(C)C(C)(C)C.
What is the InChIKey of 4-[tert-butyl(dimethyl)silyl]oxy-3,3-difluorobutan-2-ol?
The InChIKey is WQFVUFGYZDXSDD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H22F2O2Si/c1-8(13)10(11,12)7-14-15(5,6)9(2,3)4/h8,13H,7H2,1-6H3.
What are the key properties of 4-[tert-butyl(dimethyl)silyl]oxy-3,3-difluorobutan-2-ol?
4-[tert-butyl(dimethyl)silyl]oxy-3,3-difluorobutan-2-ol has a molecular weight of 240.37 g/mol, XLogP of 3.02, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[tert-butyl(dimethyl)silyl]oxy-3,3-difluorobutan-2-ol is sourced from PubChem (CID 157193869), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).