C16H28N2O4 — CID 157194967
(2S,3S)-2,3-dihydroxy-N-(4-methylpent-2-ynyl)-4-oxo-7-(propan-2-ylamino)heptanamide (PubChem CID 157194967) has the molecular formula C16H28N2O4 and a molecular weight of 312.41 g/mol. Its IUPAC name is (2S,3S)-2,3-dihydroxy-N-(4-methylpent-2-ynyl)-4-oxo-7-(propan-2-ylamino)heptanamide.
| Compound Name | (2S,3S)-2,3-dihydroxy-N-(4-methylpent-2-ynyl)-4-oxo-7-(propan-2-ylamino)heptanamide |
|---|---|
| PubChem CID | 157194967 |
| Molecular Formula | C16H28N2O4 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.20 |
| IUPAC Name | (2S,3S)-2,3-dihydroxy-N-(4-methylpent-2-ynyl)-4-oxo-7-(propan-2-ylamino)heptanamide |
| SMILES | CC(C)C#CCNC(=O)[C@@H](O)[C@H](O)C(=O)CCCNC(C)C |
| InChI | InChI=1S/C16H28N2O4/c1-11(2)7-5-10-18-16(22)15(21)14(20)13(19)8-6-9-17-12(3)4/h11-12,14-15,17,20-21H,6,8-10H2,1-4H3,(H,18,22)/t14-,15+/m1/s1 |
| InChIKey | XXEJUNUHWYJDBP-CABCVRRESA-N |
| XLogP | -0.17 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|