C27H30F2N2O3 — CID 157195078
(4aR,8aS)-6-[4-[bis(4-fluorophenyl)methyl]piperidine-1-carbonyl]-4,4a,5,7,8,8a-hexahydropyrano[3,2-c]pyridin-3-one (PubChem CID 157195078) has the molecular formula C27H30F2N2O3 and a molecular weight of 468.54 g/mol. Its IUPAC name is (4aR,8aS)-6-[4-[bis(4-fluorophenyl)methyl]piperidine-1-carbonyl]-4,4a,5,7,8,8a-hexahydropyrano[3,2-c]pyridin-3-one.
| Compound Name | (4aR,8aS)-6-[4-[bis(4-fluorophenyl)methyl]piperidine-1-carbonyl]-4,4a,5,7,8,8a-hexahydropyrano[3,2-c]pyridin-3-one |
|---|---|
| PubChem CID | 157195078 |
| Molecular Formula | C27H30F2N2O3 |
| Molecular Weight | 468.54 g/mol |
| Exact Mass | 468.22 |
| IUPAC Name | (4aR,8aS)-6-[4-[bis(4-fluorophenyl)methyl]piperidine-1-carbonyl]-4,4a,5,7,8,8a-hexahydropyrano[3,2-c]pyridin-3-one |
| SMILES | O=C1CO[C@H]2CCN(C(=O)N3CCC(C(c4ccc(F)cc4)c4ccc(F)cc4)CC3)C[C@H]2C1 |
| InChI | InChI=1S/C27H30F2N2O3/c28-22-5-1-18(2-6-22)26(19-3-7-23(29)8-4-19)20-9-12-30(13-10-20)27(33)31-14-11-25-21(16-31)15-24(32)17-34-25/h1-8,20-21,25-26H,9-17H2/t21-,25+/m1/s1 |
| InChIKey | AQDNODOHTQRRBY-BWKNWUBXSA-N |
| XLogP | 4.61 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.54 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |