About methane;5-(methylamino)-3-(methylaminomethyl)-4-oxopentanoic acid
methane;5-(methylamino)-3-(methylaminomethyl)-4-oxopentanoic acid (PubChem CID 157195550) has the molecular formula C10H24N2O3
and a molecular weight of 220.31 g/mol. Its IUPAC name is methane;5-(methylamino)-3-(methylaminomethyl)-4-oxopentanoic acid.
Molecular Properties
| Compound Name | methane;5-(methylamino)-3-(methylaminomethyl)-4-oxopentanoic acid |
| PubChem CID | 157195550 |
| Molecular Formula | C10H24N2O3 |
| Molecular Weight | 220.31 g/mol |
| Exact Mass | 220.18 |
| IUPAC Name | methane;5-(methylamino)-3-(methylaminomethyl)-4-oxopentanoic acid |
| SMILES | C.C.CNCC(=O)C(CNC)CC(=O)O |
| InChI | InChI=1S/C8H16N2O3.2CH4/c1-9-4-6(3-8(12)13)7(11)5-10-2;;/h6,9-10H,3-5H2,1-2H3,(H,12,13);2*1H4 |
| InChIKey | AQFAFSFPTYNTLS-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.31 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methane;5-(methylamino)-3-(methylaminomethyl)-4-oxopentanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;5-(methylamino)-3-(methylaminomethyl)-4-oxopentanoic acid?
The IUPAC name of methane;5-(methylamino)-3-(methylaminomethyl)-4-oxopentanoic acid (CID 157195550) is methane;5-(methylamino)-3-(methylaminomethyl)-4-oxopentanoic acid.
What is the SMILES notation for methane;5-(methylamino)-3-(methylaminomethyl)-4-oxopentanoic acid?
The canonical SMILES for methane;5-(methylamino)-3-(methylaminomethyl)-4-oxopentanoic acid is C.C.CNCC(=O)C(CNC)CC(=O)O.
What is the InChIKey of methane;5-(methylamino)-3-(methylaminomethyl)-4-oxopentanoic acid?
The InChIKey is AQFAFSFPTYNTLS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16N2O3.2CH4/c1-9-4-6(3-8(12)13)7(11)5-10-2;;/h6,9-10H,3-5H2,1-2H3,(H,12,13);2*1H4.
What are the key properties of methane;5-(methylamino)-3-(methylaminomethyl)-4-oxopentanoic acid?
methane;5-(methylamino)-3-(methylaminomethyl)-4-oxopentanoic acid has a molecular weight of 220.31 g/mol, XLogP of 0.36, 7 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methane;5-(methylamino)-3-(methylaminomethyl)-4-oxopentanoic acid is sourced from PubChem (CID 157195550), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).