About 1,2,2,3-tetramethylpiperidine
1,2,2,3-tetramethylpiperidine (PubChem CID 157196405) has the molecular formula C18H38N2
and a molecular weight of 282.52 g/mol. Its IUPAC name is 1,2,2,3-tetramethylpiperidine.
Molecular Properties
| Compound Name | 1,2,2,3-tetramethylpiperidine |
| PubChem CID | 157196405 |
| Molecular Formula | C18H38N2 |
| Molecular Weight | 282.52 g/mol |
| Exact Mass | 282.30 |
| IUPAC Name | 1,2,2,3-tetramethylpiperidine |
| SMILES | CC1CCCN(C)C1(C)C.CC1CCCN(C)C1(C)C |
| InChI | InChI=1S/2C9H19N/c2*1-8-6-5-7-10(4)9(8,2)3/h2*8H,5-7H2,1-4H3 |
| InChIKey | AQHKRLYRHIGQIU-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.52 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1,2,2,3-tetramethylpiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2,2,3-tetramethylpiperidine?
The IUPAC name of 1,2,2,3-tetramethylpiperidine (CID 157196405) is 1,2,2,3-tetramethylpiperidine.
What is the SMILES notation for 1,2,2,3-tetramethylpiperidine?
The canonical SMILES for 1,2,2,3-tetramethylpiperidine is CC1CCCN(C)C1(C)C.CC1CCCN(C)C1(C)C.
What is the InChIKey of 1,2,2,3-tetramethylpiperidine?
The InChIKey is AQHKRLYRHIGQIU-UHFFFAOYSA-N. The full InChI is InChI=1S/2C9H19N/c2*1-8-6-5-7-10(4)9(8,2)3/h2*8H,5-7H2,1-4H3.
What are the key properties of 1,2,2,3-tetramethylpiperidine?
1,2,2,3-tetramethylpiperidine has a molecular weight of 282.52 g/mol, XLogP of 4.25, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2,2,3-tetramethylpiperidine is sourced from PubChem (CID 157196405), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).