About CID 157197162
CID 157197162 (PubChem CID 157197162) has the molecular formula C8H15B2N2O2+
and a molecular weight of 192.84 g/mol.
Molecular Properties
| Compound Name | CID 157197162 |
| PubChem CID | 157197162 |
| Molecular Formula | C8H15B2N2O2+ |
| Molecular Weight | 192.84 g/mol |
| Exact Mass | 193.13 |
| IUPAC Name | — |
| SMILES | C[N+]1(CCC#N)CCOCC1.[B]B=O |
| InChI | InChI=1S/C8H15N2O.B2O/c1-10(4-2-3-9)5-7-11-8-6-10;1-2-3/h2,4-8H2,1H3;/q+1; |
| InChIKey | MOYQNXPQJAUYLF-UHFFFAOYSA-N |
| XLogP | -0.50 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.84 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze CID 157197162 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 157197162?
The IUPAC name of CID 157197162 (CID 157197162) is not available.
What is the SMILES notation for CID 157197162?
The canonical SMILES for CID 157197162 is C[N+]1(CCC#N)CCOCC1.[B]B=O.
What is the InChIKey of CID 157197162?
The InChIKey is MOYQNXPQJAUYLF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15N2O.B2O/c1-10(4-2-3-9)5-7-11-8-6-10;1-2-3/h2,4-8H2,1H3;/q+1;.
What are the key properties of CID 157197162?
CID 157197162 has a molecular weight of 192.84 g/mol, XLogP of -0.50, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 157197162 is sourced from PubChem (CID 157197162), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).