C34H44F3NO3 — CID 157197220
(4aR,6aR,6aS,6bR,8aS,12aS,14bR)-2-isocyano-4,4,6a,6b,11,11,14b-heptamethyl-8a-(4,4,4-trifluorobutanoyl)-4a,5,6,6a,7,8,9,10,12,12a-decahydropicene-3,13-dione (PubChem CID 157197220) has the molecular formula C34H44F3NO3 and a molecular weight of 571.72 g/mol. Its IUPAC name is (4aR,6aR,6aS,6bR,8aS,12aS,14bR)-2-isocyano-4,4,6a,6b,11,11,14b-heptamethyl-8a-(4,4,4-trifluorobutanoyl)-4a,5,6,6a,7,8,9,10,12,12a-decahydropicene-3,13-dione.
| Compound Name | (4aR,6aR,6aS,6bR,8aS,12aS,14bR)-2-isocyano-4,4,6a,6b,11,11,14b-heptamethyl-8a-(4,4,4-trifluorobutanoyl)-4a,5,6,6a,7,8,9,10,12,12a-decahydropicene-3,13-dione |
|---|---|
| PubChem CID | 157197220 |
| Molecular Formula | C34H44F3NO3 |
| Molecular Weight | 571.72 g/mol |
| Exact Mass | 571.33 |
| IUPAC Name | (4aR,6aR,6aS,6bR,8aS,12aS,14bR)-2-isocyano-4,4,6a,6b,11,11,14b-heptamethyl-8a-(4,4,4-trifluorobutanoyl)-4a,5,6,6a,7,8,9,10,12,12a-decahydropicene-3,13-dione |
| SMILES | [C-]#[N+]C1=C[C@]2(C)C3=CC(=O)[C@@H]4[C@@H]5CC(C)(C)CC[C@]5(C(=O)CCC(F)(F)F)CC[C@@]4(C)[C@]3(C)CC[C@H]2C(C)(C)C1=O |
| InChI | InChI=1S/C34H44F3NO3/c1-28(2)13-15-33(25(40)10-12-34(35,36)37)16-14-32(7)26(20(33)18-28)22(39)17-24-30(5)19-21(38-8)27(41)29(3,4)23(30)9-11-31(24,32)6/h17,19-20,23,26H,9-16,18H2,1-7H3/t20-,23-,26-,30-,31+,32+,33-/m0/s1 |
| InChIKey | LRHZLOPGCJKUFW-GHGVIBMYSA-N |
| XLogP | 8.47 |
| TPSA | 55.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.72 |
| LogP ≤ 5 | 8.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|