C20H25FO2 — CID 157198139
(1S)-1-(2-fluoro-3-phenylmethoxyphenyl)-4,4-dimethylpentan-1-ol (PubChem CID 157198139) has the molecular formula C20H25FO2 and a molecular weight of 316.42 g/mol. Its IUPAC name is (1S)-1-(2-fluoro-3-phenylmethoxyphenyl)-4,4-dimethylpentan-1-ol.
| Compound Name | (1S)-1-(2-fluoro-3-phenylmethoxyphenyl)-4,4-dimethylpentan-1-ol |
|---|---|
| PubChem CID | 157198139 |
| Molecular Formula | C20H25FO2 |
| Molecular Weight | 316.42 g/mol |
| Exact Mass | 316.18 |
| IUPAC Name | (1S)-1-(2-fluoro-3-phenylmethoxyphenyl)-4,4-dimethylpentan-1-ol |
| SMILES | CC(C)(C)CC[C@H](O)c1cccc(OCc2ccccc2)c1F |
| InChI | InChI=1S/C20H25FO2/c1-20(2,3)13-12-17(22)16-10-7-11-18(19(16)21)23-14-15-8-5-4-6-9-15/h4-11,17,22H,12-14H2,1-3H3/t17-/m0/s1 |
| InChIKey | GMTKQGKTBNXRTM-KRWDZBQOSA-N |
| XLogP | 5.26 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.42 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |