C26H27NO2 — CID 157198591
(3S,4R)-3-phenyl-4-(4-piperidin-1-ylphenyl)-3,4-dihydro-2H-chromen-7-ol (PubChem CID 157198591) has the molecular formula C26H27NO2 and a molecular weight of 385.51 g/mol. Its IUPAC name is (3S,4R)-3-phenyl-4-(4-piperidin-1-ylphenyl)-3,4-dihydro-2H-chromen-7-ol.
| Compound Name | (3S,4R)-3-phenyl-4-(4-piperidin-1-ylphenyl)-3,4-dihydro-2H-chromen-7-ol |
|---|---|
| PubChem CID | 157198591 |
| Molecular Formula | C26H27NO2 |
| Molecular Weight | 385.51 g/mol |
| Exact Mass | 385.20 |
| IUPAC Name | (3S,4R)-3-phenyl-4-(4-piperidin-1-ylphenyl)-3,4-dihydro-2H-chromen-7-ol |
| SMILES | Oc1ccc2c(c1)OC[C@H](c1ccccc1)[C@@H]2c1ccc(N2CCCCC2)cc1 |
| InChI | InChI=1S/C26H27NO2/c28-22-13-14-23-25(17-22)29-18-24(19-7-3-1-4-8-19)26(23)20-9-11-21(12-10-20)27-15-5-2-6-16-27/h1,3-4,7-14,17,24,26,28H,2,5-6,15-16,18H2/t24-,26-/m1/s1 |
| InChIKey | CLEIEPLOSCWCTQ-AOYPEHQESA-N |
| XLogP | 5.69 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.51 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|