C37H39NO5 — CID 15719947
2-[3-[(2S,3S,4R,5R)-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)oxolan-2-yl]phenyl]-4,4-dimethyl-5H-1,3-oxazole (PubChem CID 15719947) has the molecular formula C37H39NO5 and a molecular weight of 577.72 g/mol. Its IUPAC name is 2-[3-[(2S,3S,4R,5R)-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)oxolan-2-yl]phenyl]-4,4-dimethyl-5H-1,3-oxazole.
| Compound Name | 2-[3-[(2S,3S,4R,5R)-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)oxolan-2-yl]phenyl]-4,4-dimethyl-5H-1,3-oxazole |
|---|---|
| PubChem CID | 15719947 |
| Molecular Formula | C37H39NO5 |
| Molecular Weight | 577.72 g/mol |
| Exact Mass | 577.28 |
| IUPAC Name | 2-[3-[(2S,3S,4R,5R)-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)oxolan-2-yl]phenyl]-4,4-dimethyl-5H-1,3-oxazole |
| SMILES | CC1(C)COC(c2cccc([C@@H]3O[C@H](COCc4ccccc4)[C@@H](OCc4ccccc4)[C@H]3OCc3ccccc3)c2)=N1 |
| InChI | InChI=1S/C37H39NO5/c1-37(2)26-42-36(38-37)31-20-12-19-30(21-31)33-35(41-24-29-17-10-5-11-18-29)34(40-23-28-15-8-4-9-16-28)32(43-33)25-39-22-27-13-6-3-7-14-27/h3-21,32-35H,22-26H2,1-2H3/t32-,33+,34-,35+/m1/s1 |
| InChIKey | BDJCCKJYWYTIHI-AXXKPAGNSA-N |
| XLogP | 7.07 |
| TPSA | 58.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.72 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |