C26H28Cl2N2O3S — CID 157199824
(2S)-2-[(6-chloro-1,3-benzothiazol-2-yl)methyl]-N-[(2R)-6-chloro-5-oxo-1-phenylhexan-2-yl]-4-oxohexanamide (PubChem CID 157199824) has the molecular formula C26H28Cl2N2O3S and a molecular weight of 519.49 g/mol. Its IUPAC name is (2S)-2-[(6-chloro-1,3-benzothiazol-2-yl)methyl]-N-[(2R)-6-chloro-5-oxo-1-phenylhexan-2-yl]-4-oxohexanamide.
| Compound Name | (2S)-2-[(6-chloro-1,3-benzothiazol-2-yl)methyl]-N-[(2R)-6-chloro-5-oxo-1-phenylhexan-2-yl]-4-oxohexanamide |
|---|---|
| PubChem CID | 157199824 |
| Molecular Formula | C26H28Cl2N2O3S |
| Molecular Weight | 519.49 g/mol |
| Exact Mass | 518.12 |
| IUPAC Name | (2S)-2-[(6-chloro-1,3-benzothiazol-2-yl)methyl]-N-[(2R)-6-chloro-5-oxo-1-phenylhexan-2-yl]-4-oxohexanamide |
| SMILES | CCC(=O)C[C@@H](Cc1nc2ccc(Cl)cc2s1)C(=O)N[C@H](CCC(=O)CCl)Cc1ccccc1 |
| InChI | InChI=1S/C26H28Cl2N2O3S/c1-2-21(31)13-18(14-25-30-23-11-8-19(28)15-24(23)34-25)26(33)29-20(9-10-22(32)16-27)12-17-6-4-3-5-7-17/h3-8,11,15,18,20H,2,9-10,12-14,16H2,1H3,(H,29,33)/t18-,20+/m0/s1 |
| InChIKey | YTJKSCOAPWFOJG-AZUAARDMSA-N |
| XLogP | 5.79 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.49 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|