C23H20FN5O3 — CID 157199905
1-[6-(azetidin-1-yl)-1,3-dihydropyrrolo[3,4-c]pyridin-2-yl]-2-[6-(4-fluorophenyl)-3-nitro-2-pyridinyl]ethanone (PubChem CID 157199905) has the molecular formula C23H20FN5O3 and a molecular weight of 433.44 g/mol. Its IUPAC name is 1-[6-(azetidin-1-yl)-1,3-dihydropyrrolo[3,4-c]pyridin-2-yl]-2-[6-(4-fluorophenyl)-3-nitro-2-pyridinyl]ethanone.
| Compound Name | 1-[6-(azetidin-1-yl)-1,3-dihydropyrrolo[3,4-c]pyridin-2-yl]-2-[6-(4-fluorophenyl)-3-nitro-2-pyridinyl]ethanone |
|---|---|
| PubChem CID | 157199905 |
| Molecular Formula | C23H20FN5O3 |
| Molecular Weight | 433.44 g/mol |
| Exact Mass | 433.16 |
| IUPAC Name | 1-[6-(azetidin-1-yl)-1,3-dihydropyrrolo[3,4-c]pyridin-2-yl]-2-[6-(4-fluorophenyl)-3-nitro-2-pyridinyl]ethanone |
| SMILES | O=C(Cc1nc(-c2ccc(F)cc2)ccc1[N+](=O)[O-])N1Cc2cnc(N3CCC3)cc2C1 |
| InChI | InChI=1S/C23H20FN5O3/c24-18-4-2-15(3-5-18)19-6-7-21(29(31)32)20(26-19)11-23(30)28-13-16-10-22(27-8-1-9-27)25-12-17(16)14-28/h2-7,10,12H,1,8-9,11,13-14H2 |
| InChIKey | WCTAKWFCTFVEDO-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 92.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.44 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|