About 1-methyl-5-(3-methylpentan-2-ylamino)-2,6-dihydropyridin-3-one;molecular hydrogen
1-methyl-5-(3-methylpentan-2-ylamino)-2,6-dihydropyridin-3-one;molecular hydrogen (PubChem CID 157200093) has the molecular formula C12H24N2O
and a molecular weight of 212.34 g/mol. Its IUPAC name is 1-methyl-5-(3-methylpentan-2-ylamino)-2,6-dihydropyridin-3-one;molecular hydrogen.
Molecular Properties
| Compound Name | 1-methyl-5-(3-methylpentan-2-ylamino)-2,6-dihydropyridin-3-one;molecular hydrogen |
| PubChem CID | 157200093 |
| Molecular Formula | C12H24N2O |
| Molecular Weight | 212.34 g/mol |
| Exact Mass | 212.19 |
| IUPAC Name | 1-methyl-5-(3-methylpentan-2-ylamino)-2,6-dihydropyridin-3-one;molecular hydrogen |
| SMILES | CCC(C)C(C)NC1=CC(=O)CN(C)C1.[H][H] |
| InChI | InChI=1S/C12H22N2O.H2/c1-5-9(2)10(3)13-11-6-12(15)8-14(4)7-11;/h6,9-10,13H,5,7-8H2,1-4H3;1H |
| InChIKey | AQRVYQJXXHZLQO-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.34 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-methyl-5-(3-methylpentan-2-ylamino)-2,6-dihydropyridin-3-one;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-5-(3-methylpentan-2-ylamino)-2,6-dihydropyridin-3-one;molecular hydrogen?
The IUPAC name of 1-methyl-5-(3-methylpentan-2-ylamino)-2,6-dihydropyridin-3-one;molecular hydrogen (CID 157200093) is 1-methyl-5-(3-methylpentan-2-ylamino)-2,6-dihydropyridin-3-one;molecular hydrogen.
What is the SMILES notation for 1-methyl-5-(3-methylpentan-2-ylamino)-2,6-dihydropyridin-3-one;molecular hydrogen?
The canonical SMILES for 1-methyl-5-(3-methylpentan-2-ylamino)-2,6-dihydropyridin-3-one;molecular hydrogen is CCC(C)C(C)NC1=CC(=O)CN(C)C1.[H][H].
What is the InChIKey of 1-methyl-5-(3-methylpentan-2-ylamino)-2,6-dihydropyridin-3-one;molecular hydrogen?
The InChIKey is AQRVYQJXXHZLQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22N2O.H2/c1-5-9(2)10(3)13-11-6-12(15)8-14(4)7-11;/h6,9-10,13H,5,7-8H2,1-4H3;1H.
What are the key properties of 1-methyl-5-(3-methylpentan-2-ylamino)-2,6-dihydropyridin-3-one;molecular hydrogen?
1-methyl-5-(3-methylpentan-2-ylamino)-2,6-dihydropyridin-3-one;molecular hydrogen has a molecular weight of 212.34 g/mol, XLogP of 1.65, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-5-(3-methylpentan-2-ylamino)-2,6-dihydropyridin-3-one;molecular hydrogen is sourced from PubChem (CID 157200093), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).