C30H35ClN2O4S — CID 157203558
(3'R,4S,6'R,10'Z)-7-chloro-13',13'-dioxospiro[2,3-dihydro-1H-naphthalene-4,22'-20-oxa-13λ6-thia-1,14-diazatetracyclo[14.7.2.03,6.019,24]pentacosa-10,16(25),17,19(24)-tetraene]-15'-one (PubChem CID 157203558) has the molecular formula C30H35ClN2O4S and a molecular weight of 555.14 g/mol. Its IUPAC name is (3'R,4S,6'R,10'Z)-7-chloro-13',13'-dioxospiro[2,3-dihydro-1H-naphthalene-4,22'-20-oxa-13λ6-thia-1,14-diazatetracyclo[14.7.2.03,6.019,24]pentacosa-10,16(25),17,19(24)-tetraene]-15'-one.
| Compound Name | (3'R,4S,6'R,10'Z)-7-chloro-13',13'-dioxospiro[2,3-dihydro-1H-naphthalene-4,22'-20-oxa-13λ6-thia-1,14-diazatetracyclo[14.7.2.03,6.019,24]pentacosa-10,16(25),17,19(24)-tetraene]-15'-one |
|---|---|
| PubChem CID | 157203558 |
| Molecular Formula | C30H35ClN2O4S |
| Molecular Weight | 555.14 g/mol |
| Exact Mass | 554.20 |
| IUPAC Name | (3'R,4S,6'R,10'Z)-7-chloro-13',13'-dioxospiro[2,3-dihydro-1H-naphthalene-4,22'-20-oxa-13λ6-thia-1,14-diazatetracyclo[14.7.2.03,6.019,24]pentacosa-10,16(25),17,19(24)-tetraene]-15'-one |
| SMILES | O=C1NS(=O)(=O)C/C=C\CCC[C@@H]2CC[C@H]2CN2C[C@@]3(CCCc4cc(Cl)ccc43)COc3ccc1cc32 |
| InChI | InChI=1S/C30H35ClN2O4S/c31-25-11-12-26-22(16-25)7-5-14-30(26)19-33-18-24-9-8-21(24)6-3-1-2-4-15-38(35,36)32-29(34)23-10-13-28(37-20-30)27(33)17-23/h2,4,10-13,16-17,21,24H,1,3,5-9,14-15,18-20H2,(H,32,34)/b4-2-/t21-,24+,30+/m1/s1 |
| InChIKey | BPSKNUMOBBAGPE-MBYRAXSHSA-N |
| XLogP | 5.64 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.14 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|