About (2,2-dimethyl-3,4-dihydro-1H-quinolin-6-yl)methanol
(2,2-dimethyl-3,4-dihydro-1H-quinolin-6-yl)methanol (PubChem CID 15720423) has the molecular formula C12H17NO
and a molecular weight of 191.27 g/mol. Its IUPAC name is (2,2-dimethyl-3,4-dihydro-1H-quinolin-6-yl)methanol.
Molecular Properties
| Compound Name | (2,2-dimethyl-3,4-dihydro-1H-quinolin-6-yl)methanol |
| PubChem CID | 15720423 |
| Molecular Formula | C12H17NO |
| Molecular Weight | 191.27 g/mol |
| Exact Mass | 191.13 |
| IUPAC Name | (2,2-dimethyl-3,4-dihydro-1H-quinolin-6-yl)methanol |
| SMILES | CC1(C)CCc2cc(CO)ccc2N1 |
| InChI | InChI=1S/C12H17NO/c1-12(2)6-5-10-7-9(8-14)3-4-11(10)13-12/h3-4,7,13-14H,5-6,8H2,1-2H3 |
| InChIKey | ICQYIWGFOILQSU-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.27 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2,2-dimethyl-3,4-dihydro-1H-quinolin-6-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,2-dimethyl-3,4-dihydro-1H-quinolin-6-yl)methanol?
The IUPAC name of (2,2-dimethyl-3,4-dihydro-1H-quinolin-6-yl)methanol (CID 15720423) is (2,2-dimethyl-3,4-dihydro-1H-quinolin-6-yl)methanol.
What is the SMILES notation for (2,2-dimethyl-3,4-dihydro-1H-quinolin-6-yl)methanol?
The canonical SMILES for (2,2-dimethyl-3,4-dihydro-1H-quinolin-6-yl)methanol is CC1(C)CCc2cc(CO)ccc2N1.
What is the InChIKey of (2,2-dimethyl-3,4-dihydro-1H-quinolin-6-yl)methanol?
The InChIKey is ICQYIWGFOILQSU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17NO/c1-12(2)6-5-10-7-9(8-14)3-4-11(10)13-12/h3-4,7,13-14H,5-6,8H2,1-2H3.
What are the key properties of (2,2-dimethyl-3,4-dihydro-1H-quinolin-6-yl)methanol?
(2,2-dimethyl-3,4-dihydro-1H-quinolin-6-yl)methanol has a molecular weight of 191.27 g/mol, XLogP of 2.32, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2,2-dimethyl-3,4-dihydro-1H-quinolin-6-yl)methanol is sourced from PubChem (CID 15720423), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).