About 1-[[2,6-di(propan-2-yl)phenoxy]methylidene]piperidin-1-ium chloride
1-[[2,6-di(propan-2-yl)phenoxy]methylidene]piperidin-1-ium chloride (PubChem CID 157205545) has the molecular formula C18H28ClNO
and a molecular weight of 309.88 g/mol. Its IUPAC name is 1-[[2,6-di(propan-2-yl)phenoxy]methylidene]piperidin-1-ium chloride.
Molecular Properties
| Compound Name | 1-[[2,6-di(propan-2-yl)phenoxy]methylidene]piperidin-1-ium chloride |
| PubChem CID | 157205545 |
| Molecular Formula | C18H28ClNO |
| Molecular Weight | 309.88 g/mol |
| Exact Mass | 309.19 |
| IUPAC Name | 1-[[2,6-di(propan-2-yl)phenoxy]methylidene]piperidin-1-ium chloride |
| SMILES | CC(C)c1cccc(C(C)C)c1OC=[N+]1CCCCC1.[Cl-] |
| InChI | InChI=1S/C18H28NO.ClH/c1-14(2)16-9-8-10-17(15(3)4)18(16)20-13-19-11-6-5-7-12-19;/h8-10,13-15H,5-7,11-12H2,1-4H3;1H/q+1;/p-1 |
| InChIKey | UMECEUSICCKGNB-UHFFFAOYSA-M |
| XLogP | 1.54 |
| TPSA | 12.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.88 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 1-[[2,6-di(propan-2-yl)phenoxy]methylidene]piperidin-1-ium chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[2,6-di(propan-2-yl)phenoxy]methylidene]piperidin-1-ium chloride?
The IUPAC name of 1-[[2,6-di(propan-2-yl)phenoxy]methylidene]piperidin-1-ium chloride (CID 157205545) is 1-[[2,6-di(propan-2-yl)phenoxy]methylidene]piperidin-1-ium chloride.
What is the SMILES notation for 1-[[2,6-di(propan-2-yl)phenoxy]methylidene]piperidin-1-ium chloride?
The canonical SMILES for 1-[[2,6-di(propan-2-yl)phenoxy]methylidene]piperidin-1-ium chloride is CC(C)c1cccc(C(C)C)c1OC=[N+]1CCCCC1.[Cl-].
What is the InChIKey of 1-[[2,6-di(propan-2-yl)phenoxy]methylidene]piperidin-1-ium chloride?
The InChIKey is UMECEUSICCKGNB-UHFFFAOYSA-M. The full InChI is InChI=1S/C18H28NO.ClH/c1-14(2)16-9-8-10-17(15(3)4)18(16)20-13-19-11-6-5-7-12-19;/h8-10,13-15H,5-7,11-12H2,1-4H3;1H/q+1;/p-1.
What are the key properties of 1-[[2,6-di(propan-2-yl)phenoxy]methylidene]piperidin-1-ium chloride?
1-[[2,6-di(propan-2-yl)phenoxy]methylidene]piperidin-1-ium chloride has a molecular weight of 309.88 g/mol, XLogP of 1.54, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[2,6-di(propan-2-yl)phenoxy]methylidene]piperidin-1-ium chloride is sourced from PubChem (CID 157205545), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).