About 2,2-dimethylhept-6-enal;2,2-dimethylhept-6-en-1-ol
2,2-dimethylhept-6-enal;2,2-dimethylhept-6-en-1-ol (PubChem CID 157207158) has the molecular formula C18H34O2
and a molecular weight of 282.47 g/mol. Its IUPAC name is 2,2-dimethylhept-6-enal;2,2-dimethylhept-6-en-1-ol.
Molecular Properties
| Compound Name | 2,2-dimethylhept-6-enal;2,2-dimethylhept-6-en-1-ol |
| PubChem CID | 157207158 |
| Molecular Formula | C18H34O2 |
| Molecular Weight | 282.47 g/mol |
| Exact Mass | 282.26 |
| IUPAC Name | 2,2-dimethylhept-6-enal;2,2-dimethylhept-6-en-1-ol |
| SMILES | C=CCCCC(C)(C)C=O.C=CCCCC(C)(C)CO |
| InChI | InChI=1S/C9H18O.C9H16O/c2*1-4-5-6-7-9(2,3)8-10/h4,10H,1,5-8H2,2-3H3;4,8H,1,5-7H2,2-3H3 |
| InChIKey | ARMHWSVQHMYJKC-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.47 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2,2-dimethylhept-6-enal;2,2-dimethylhept-6-en-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dimethylhept-6-enal;2,2-dimethylhept-6-en-1-ol?
The IUPAC name of 2,2-dimethylhept-6-enal;2,2-dimethylhept-6-en-1-ol (CID 157207158) is 2,2-dimethylhept-6-enal;2,2-dimethylhept-6-en-1-ol.
What is the SMILES notation for 2,2-dimethylhept-6-enal;2,2-dimethylhept-6-en-1-ol?
The canonical SMILES for 2,2-dimethylhept-6-enal;2,2-dimethylhept-6-en-1-ol is C=CCCCC(C)(C)C=O.C=CCCCC(C)(C)CO.
What is the InChIKey of 2,2-dimethylhept-6-enal;2,2-dimethylhept-6-en-1-ol?
The InChIKey is ARMHWSVQHMYJKC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18O.C9H16O/c2*1-4-5-6-7-9(2,3)8-10/h4,10H,1,5-8H2,2-3H3;4,8H,1,5-7H2,2-3H3.
What are the key properties of 2,2-dimethylhept-6-enal;2,2-dimethylhept-6-en-1-ol?
2,2-dimethylhept-6-enal;2,2-dimethylhept-6-en-1-ol has a molecular weight of 282.47 g/mol, XLogP of 4.93, 10 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dimethylhept-6-enal;2,2-dimethylhept-6-en-1-ol is sourced from PubChem (CID 157207158), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).