C50H40 — CID 157207243
7,12-bis(3,5-dimethylphenyl)-3,9-bis(3-methylphenyl)benzo[k]fluoranthene (PubChem CID 157207243) has the molecular formula C50H40 and a molecular weight of 640.87 g/mol. Its IUPAC name is 7,12-bis(3,5-dimethylphenyl)-3,9-bis(3-methylphenyl)benzo[k]fluoranthene.
| Compound Name | 7,12-bis(3,5-dimethylphenyl)-3,9-bis(3-methylphenyl)benzo[k]fluoranthene |
|---|---|
| PubChem CID | 157207243 |
| Molecular Formula | C50H40 |
| Molecular Weight | 640.87 g/mol |
| Exact Mass | 640.31 |
| IUPAC Name | 7,12-bis(3,5-dimethylphenyl)-3,9-bis(3-methylphenyl)benzo[k]fluoranthene |
| SMILES | Cc1cccc(-c2ccc3c(-c4cc(C)cc(C)c4)c4c(c(-c5cc(C)cc(C)c5)c3c2)-c2cccc3c(-c5cccc(C)c5)ccc-4c23)c1 |
| InChI | InChI=1S/C50H40/c1-29-10-7-12-35(22-29)36-16-17-42-45(28-36)47(39-26-33(5)21-34(6)27-39)49-43-15-9-14-41-40(37-13-8-11-30(2)23-37)18-19-44(48(41)43)50(49)46(42)38-24-31(3)20-32(4)25-38/h7-28H,1-6H3 |
| InChIKey | LOEZIFYFTPMHBG-UHFFFAOYSA-N |
| XLogP | 14.16 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.87 |
| LogP ≤ 5 | 14.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |