About cyclopropane;ethane;2-methylpropane
cyclopropane;ethane;2-methylpropane (PubChem CID 157207682) has the molecular formula C16H40
and a molecular weight of 232.50 g/mol. Its IUPAC name is cyclopropane;ethane;2-methylpropane.
Molecular Properties
| Compound Name | cyclopropane;ethane;2-methylpropane |
| PubChem CID | 157207682 |
| Molecular Formula | C16H40 |
| Molecular Weight | 232.50 g/mol |
| Exact Mass | 232.31 |
| IUPAC Name | cyclopropane;ethane;2-methylpropane |
| SMILES | C1CC1.C1CC1.CC.CC.CC.CC(C)C |
| InChI | InChI=1S/C4H10.2C3H6.3C2H6/c1-4(2)3;2*1-2-3-1;3*1-2/h4H,1-3H3;2*1-3H2;3*1-2H3 |
| InChIKey | ARNOBJSHOIBGQB-UHFFFAOYSA-N |
| XLogP | 7.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 232.50 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze cyclopropane;ethane;2-methylpropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopropane;ethane;2-methylpropane?
The IUPAC name of cyclopropane;ethane;2-methylpropane (CID 157207682) is cyclopropane;ethane;2-methylpropane.
What is the SMILES notation for cyclopropane;ethane;2-methylpropane?
The canonical SMILES for cyclopropane;ethane;2-methylpropane is C1CC1.C1CC1.CC.CC.CC.CC(C)C.
What is the InChIKey of cyclopropane;ethane;2-methylpropane?
The InChIKey is ARNOBJSHOIBGQB-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10.2C3H6.3C2H6/c1-4(2)3;2*1-2-3-1;3*1-2/h4H,1-3H3;2*1-3H2;3*1-2H3.
What are the key properties of cyclopropane;ethane;2-methylpropane?
cyclopropane;ethane;2-methylpropane has a molecular weight of 232.50 g/mol, XLogP of 7.08, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopropane;ethane;2-methylpropane is sourced from PubChem (CID 157207682), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).