C32H60N2O8 — CID 157208345
3-[3,3-dimethylbutyl-[3-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]propanoyl]amino]-N-[(3S,6R)-2,6,8,8-tetramethyl-4,7-dioxononan-3-yl]propanamide (PubChem CID 157208345) has the molecular formula C32H60N2O8 and a molecular weight of 600.84 g/mol. Its IUPAC name is 3-[3,3-dimethylbutyl-[3-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]propanoyl]amino]-N-[(3S,6R)-2,6,8,8-tetramethyl-4,7-dioxononan-3-yl]propanamide.
| Compound Name | 3-[3,3-dimethylbutyl-[3-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]propanoyl]amino]-N-[(3S,6R)-2,6,8,8-tetramethyl-4,7-dioxononan-3-yl]propanamide |
|---|---|
| PubChem CID | 157208345 |
| Molecular Formula | C32H60N2O8 |
| Molecular Weight | 600.84 g/mol |
| Exact Mass | 600.43 |
| IUPAC Name | 3-[3,3-dimethylbutyl-[3-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]propanoyl]amino]-N-[(3S,6R)-2,6,8,8-tetramethyl-4,7-dioxononan-3-yl]propanamide |
| SMILES | COCCOCCOCCOCCC(=O)N(CCC(=O)N[C@H](C(=O)C[C@@H](C)C(=O)C(C)(C)C)C(C)C)CCC(C)(C)C |
| InChI | InChI=1S/C32H60N2O8/c1-24(2)29(26(35)23-25(3)30(38)32(7,8)9)33-27(36)11-14-34(15-13-31(4,5)6)28(37)12-16-40-19-20-42-22-21-41-18-17-39-10/h24-25,29H,11-23H2,1-10H3,(H,33,36)/t25-,29+/m1/s1 |
| InChIKey | DLMUXUNHKVUAOY-IRPSRAIASA-N |
| XLogP | 4.08 |
| TPSA | 120.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.84 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|