About 2-chloro-4-(3-fluorophenyl)pyridine;2-chloro-4-iodopyridine;(3-fluorophenyl)boronic acid
2-chloro-4-(3-fluorophenyl)pyridine;2-chloro-4-iodopyridine;(3-fluorophenyl)boronic acid (PubChem CID 157208464) has the molecular formula C22H16BCl2F2IN2O2
and a molecular weight of 587.00 g/mol. Its IUPAC name is 2-chloro-4-(3-fluorophenyl)pyridine;2-chloro-4-iodopyridine;(3-fluorophenyl)boronic acid.
Molecular Properties
| Compound Name | 2-chloro-4-(3-fluorophenyl)pyridine;2-chloro-4-iodopyridine;(3-fluorophenyl)boronic acid |
| PubChem CID | 157208464 |
| Molecular Formula | C22H16BCl2F2IN2O2 |
| Molecular Weight | 587.00 g/mol |
| Exact Mass | 585.97 |
| IUPAC Name | 2-chloro-4-(3-fluorophenyl)pyridine;2-chloro-4-iodopyridine;(3-fluorophenyl)boronic acid |
| SMILES | Clc1cc(I)ccn1.Fc1cccc(-c2ccnc(Cl)c2)c1.OB(O)c1cccc(F)c1 |
| InChI | InChI=1S/C11H7ClFN.C6H6BFO2.C5H3ClIN/c12-11-7-9(4-5-14-11)8-2-1-3-10(13)6-8;8-6-3-1-2-5(4-6)7(9)10;6-5-3-4(7)1-2-8-5/h1-7H;1-4,9-10H;1-3H |
| InChIKey | ARPWARGVLCTEKD-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 66.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 587.00 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-4-(3-fluorophenyl)pyridine;2-chloro-4-iodopyridine;(3-fluorophenyl)boronic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-4-(3-fluorophenyl)pyridine;2-chloro-4-iodopyridine;(3-fluorophenyl)boronic acid?
The IUPAC name of 2-chloro-4-(3-fluorophenyl)pyridine;2-chloro-4-iodopyridine;(3-fluorophenyl)boronic acid (CID 157208464) is 2-chloro-4-(3-fluorophenyl)pyridine;2-chloro-4-iodopyridine;(3-fluorophenyl)boronic acid.
What is the SMILES notation for 2-chloro-4-(3-fluorophenyl)pyridine;2-chloro-4-iodopyridine;(3-fluorophenyl)boronic acid?
The canonical SMILES for 2-chloro-4-(3-fluorophenyl)pyridine;2-chloro-4-iodopyridine;(3-fluorophenyl)boronic acid is Clc1cc(I)ccn1.Fc1cccc(-c2ccnc(Cl)c2)c1.OB(O)c1cccc(F)c1.
What is the InChIKey of 2-chloro-4-(3-fluorophenyl)pyridine;2-chloro-4-iodopyridine;(3-fluorophenyl)boronic acid?
The InChIKey is ARPWARGVLCTEKD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H7ClFN.C6H6BFO2.C5H3ClIN/c12-11-7-9(4-5-14-11)8-2-1-3-10(13)6-8;8-6-3-1-2-5(4-6)7(9)10;6-5-3-4(7)1-2-8-5/h1-7H;1-4,9-10H;1-3H.
What are the key properties of 2-chloro-4-(3-fluorophenyl)pyridine;2-chloro-4-iodopyridine;(3-fluorophenyl)boronic acid?
2-chloro-4-(3-fluorophenyl)pyridine;2-chloro-4-iodopyridine;(3-fluorophenyl)boronic acid has a molecular weight of 587.00 g/mol, XLogP of 5.39, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-4-(3-fluorophenyl)pyridine;2-chloro-4-iodopyridine;(3-fluorophenyl)boronic acid is sourced from PubChem (CID 157208464), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).