C41H43N4O8S2+ — CID 157208643
4-[bis[4-(3-acetamido-2,4,6-trimethylanilino)phenyl]methyl]benzene-1,3-disulfonic acid (PubChem CID 157208643) has the molecular formula C41H43N4O8S2+ and a molecular weight of 783.95 g/mol. Its IUPAC name is 4-[bis[4-(3-acetamido-2,4,6-trimethylanilino)phenyl]methyl]benzene-1,3-disulfonic acid.
| Compound Name | 4-[bis[4-(3-acetamido-2,4,6-trimethylanilino)phenyl]methyl]benzene-1,3-disulfonic acid |
|---|---|
| PubChem CID | 157208643 |
| Molecular Formula | C41H43N4O8S2+ |
| Molecular Weight | 783.95 g/mol |
| Exact Mass | 783.25 |
| IUPAC Name | 4-[bis[4-(3-acetamido-2,4,6-trimethylanilino)phenyl]methyl]benzene-1,3-disulfonic acid |
| SMILES | CC(=O)Nc1c(C)cc(C)c(Nc2ccc([C+](c3ccc(Nc4c(C)cc(C)c(NC(C)=O)c4C)cc3)c3ccc(S(=O)(=O)O)cc3S(=O)(=O)O)cc2)c1C |
| InChI | InChI=1S/C41H42N4O8S2/c1-22-19-24(3)40(26(5)38(22)42-28(7)46)44-32-13-9-30(10-14-32)37(35-18-17-34(54(48,49)50)21-36(35)55(51,52)53)31-11-15-33(16-12-31)45-41-25(4)20-23(2)39(27(41)6)43-29(8)47/h9-21,44-45H,1-8H3,(H3-,42,43,46,47,48,49,50,51,52,53)/p+1 |
| InChIKey | VRLVHVYVWOAWRC-UHFFFAOYSA-O |
| XLogP | 8.45 |
| TPSA | 191.00 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 55 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 783.95 |
| LogP ≤ 5 | 8.45 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|