About sodium [2,3-dimethyl-4-(trifluoromethyl)benzoyl]-(1-propyltetrazol-5-yl)azanide
sodium [2,3-dimethyl-4-(trifluoromethyl)benzoyl]-(1-propyltetrazol-5-yl)azanide (PubChem CID 157209842) has the molecular formula C14H15F3N5NaO
and a molecular weight of 349.29 g/mol. Its IUPAC name is sodium [2,3-dimethyl-4-(trifluoromethyl)benzoyl]-(1-propyltetrazol-5-yl)azanide.
Molecular Properties
| Compound Name | sodium [2,3-dimethyl-4-(trifluoromethyl)benzoyl]-(1-propyltetrazol-5-yl)azanide |
| PubChem CID | 157209842 |
| Molecular Formula | C14H15F3N5NaO |
| Molecular Weight | 349.29 g/mol |
| Exact Mass | 349.11 |
| IUPAC Name | sodium [2,3-dimethyl-4-(trifluoromethyl)benzoyl]-(1-propyltetrazol-5-yl)azanide |
| SMILES | CCCn1nnnc1[N-]C(=O)c1ccc(C(F)(F)F)c(C)c1C.[Na+] |
| InChI | InChI=1S/C14H16F3N5O.Na/c1-4-7-22-13(19-20-21-22)18-12(23)10-5-6-11(14(15,16)17)9(3)8(10)2;/h5-6H,4,7H2,1-3H3,(H,18,19,21,23);/q;+1/p-1 |
| InChIKey | XVMHXDBKXUNDLY-UHFFFAOYSA-M |
| XLogP | 0.57 |
| TPSA | 74.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.29 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze sodium [2,3-dimethyl-4-(trifluoromethyl)benzoyl]-(1-propyltetrazol-5-yl)azanide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium [2,3-dimethyl-4-(trifluoromethyl)benzoyl]-(1-propyltetrazol-5-yl)azanide?
The IUPAC name of sodium [2,3-dimethyl-4-(trifluoromethyl)benzoyl]-(1-propyltetrazol-5-yl)azanide (CID 157209842) is sodium [2,3-dimethyl-4-(trifluoromethyl)benzoyl]-(1-propyltetrazol-5-yl)azanide.
What is the SMILES notation for sodium [2,3-dimethyl-4-(trifluoromethyl)benzoyl]-(1-propyltetrazol-5-yl)azanide?
The canonical SMILES for sodium [2,3-dimethyl-4-(trifluoromethyl)benzoyl]-(1-propyltetrazol-5-yl)azanide is CCCn1nnnc1[N-]C(=O)c1ccc(C(F)(F)F)c(C)c1C.[Na+].
What is the InChIKey of sodium [2,3-dimethyl-4-(trifluoromethyl)benzoyl]-(1-propyltetrazol-5-yl)azanide?
The InChIKey is XVMHXDBKXUNDLY-UHFFFAOYSA-M. The full InChI is InChI=1S/C14H16F3N5O.Na/c1-4-7-22-13(19-20-21-22)18-12(23)10-5-6-11(14(15,16)17)9(3)8(10)2;/h5-6H,4,7H2,1-3H3,(H,18,19,21,23);/q;+1/p-1.
What are the key properties of sodium [2,3-dimethyl-4-(trifluoromethyl)benzoyl]-(1-propyltetrazol-5-yl)azanide?
sodium [2,3-dimethyl-4-(trifluoromethyl)benzoyl]-(1-propyltetrazol-5-yl)azanide has a molecular weight of 349.29 g/mol, XLogP of 0.57, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for sodium [2,3-dimethyl-4-(trifluoromethyl)benzoyl]-(1-propyltetrazol-5-yl)azanide is sourced from PubChem (CID 157209842), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).