About methyl 2-oxo-1-oxaspiro[4.5]deca-3,8-diene-6-carboxylate
methyl 2-oxo-1-oxaspiro[4.5]deca-3,8-diene-6-carboxylate (PubChem CID 15721054) has the molecular formula C11H12O4
and a molecular weight of 208.21 g/mol. Its IUPAC name is methyl 2-oxo-1-oxaspiro[4.5]deca-3,8-diene-6-carboxylate.
Molecular Properties
| Compound Name | methyl 2-oxo-1-oxaspiro[4.5]deca-3,8-diene-6-carboxylate |
| PubChem CID | 15721054 |
| Molecular Formula | C11H12O4 |
| Molecular Weight | 208.21 g/mol |
| Exact Mass | 208.07 |
| IUPAC Name | methyl 2-oxo-1-oxaspiro[4.5]deca-3,8-diene-6-carboxylate |
| SMILES | COC(=O)C1CC=CCC12C=CC(=O)O2 |
| InChI | InChI=1S/C11H12O4/c1-14-10(13)8-4-2-3-6-11(8)7-5-9(12)15-11/h2-3,5,7-8H,4,6H2,1H3 |
| InChIKey | KDSOGAQMSKWLFT-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.21 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-oxo-1-oxaspiro[4.5]deca-3,8-diene-6-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-oxo-1-oxaspiro[4.5]deca-3,8-diene-6-carboxylate?
The IUPAC name of methyl 2-oxo-1-oxaspiro[4.5]deca-3,8-diene-6-carboxylate (CID 15721054) is methyl 2-oxo-1-oxaspiro[4.5]deca-3,8-diene-6-carboxylate.
What is the SMILES notation for methyl 2-oxo-1-oxaspiro[4.5]deca-3,8-diene-6-carboxylate?
The canonical SMILES for methyl 2-oxo-1-oxaspiro[4.5]deca-3,8-diene-6-carboxylate is COC(=O)C1CC=CCC12C=CC(=O)O2.
What is the InChIKey of methyl 2-oxo-1-oxaspiro[4.5]deca-3,8-diene-6-carboxylate?
The InChIKey is KDSOGAQMSKWLFT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12O4/c1-14-10(13)8-4-2-3-6-11(8)7-5-9(12)15-11/h2-3,5,7-8H,4,6H2,1H3.
What are the key properties of methyl 2-oxo-1-oxaspiro[4.5]deca-3,8-diene-6-carboxylate?
methyl 2-oxo-1-oxaspiro[4.5]deca-3,8-diene-6-carboxylate has a molecular weight of 208.21 g/mol, XLogP of 0.98, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-oxo-1-oxaspiro[4.5]deca-3,8-diene-6-carboxylate is sourced from PubChem (CID 15721054), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).