C32H43N5O5 — CID 157211293
[(E,3S)-8-(dimethylamino)-1-[1-[[3,6-dimethyl-7-(2-methylpropyl)-1H-pyrrolo[3,2-b]pyridin-2-yl]methyl]-2-oxo-3-pyridinyl]-2,8-dioxooct-6-en-3-yl] N,N-dimethylcarbamate (PubChem CID 157211293) has the molecular formula C32H43N5O5 and a molecular weight of 577.73 g/mol. Its IUPAC name is [(E,3S)-8-(dimethylamino)-1-[1-[[3,6-dimethyl-7-(2-methylpropyl)-1H-pyrrolo[3,2-b]pyridin-2-yl]methyl]-2-oxo-3-pyridinyl]-2,8-dioxooct-6-en-3-yl] N,N-dimethylcarbamate.
| Compound Name | [(E,3S)-8-(dimethylamino)-1-[1-[[3,6-dimethyl-7-(2-methylpropyl)-1H-pyrrolo[3,2-b]pyridin-2-yl]methyl]-2-oxo-3-pyridinyl]-2,8-dioxooct-6-en-3-yl] N,N-dimethylcarbamate |
|---|---|
| PubChem CID | 157211293 |
| Molecular Formula | C32H43N5O5 |
| Molecular Weight | 577.73 g/mol |
| Exact Mass | 577.33 |
| IUPAC Name | [(E,3S)-8-(dimethylamino)-1-[1-[[3,6-dimethyl-7-(2-methylpropyl)-1H-pyrrolo[3,2-b]pyridin-2-yl]methyl]-2-oxo-3-pyridinyl]-2,8-dioxooct-6-en-3-yl] N,N-dimethylcarbamate |
| SMILES | Cc1cnc2c(C)c(Cn3cccc(CC(=O)[C@H](CC/C=C/C(=O)N(C)C)OC(=O)N(C)C)c3=O)[nH]c2c1CC(C)C |
| InChI | InChI=1S/C32H43N5O5/c1-20(2)16-24-21(3)18-33-29-22(4)25(34-30(24)29)19-37-15-11-12-23(31(37)40)17-26(38)27(42-32(41)36(7)8)13-9-10-14-28(39)35(5)6/h10-12,14-15,18,20,27,34H,9,13,16-17,19H2,1-8H3/b14-10+/t27-/m0/s1 |
| InChIKey | ARXLYTOXUDEMOI-UBRULYAKSA-N |
| XLogP | 4.19 |
| TPSA | 117.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.73 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|