About 3-(1H-indol-7-yl)propanenitrile;propanenitrile
3-(1H-indol-7-yl)propanenitrile;propanenitrile (PubChem CID 157211357) has the molecular formula C14H15N3
and a molecular weight of 225.29 g/mol. Its IUPAC name is 3-(1H-indol-7-yl)propanenitrile;propanenitrile.
Molecular Properties
| Compound Name | 3-(1H-indol-7-yl)propanenitrile;propanenitrile |
| PubChem CID | 157211357 |
| Molecular Formula | C14H15N3 |
| Molecular Weight | 225.29 g/mol |
| Exact Mass | 225.13 |
| IUPAC Name | 3-(1H-indol-7-yl)propanenitrile;propanenitrile |
| SMILES | CCC#N.N#CCCc1cccc2cc[nH]c12 |
| InChI | InChI=1S/C11H10N2.C3H5N/c12-7-2-5-9-3-1-4-10-6-8-13-11(9)10;1-2-3-4/h1,3-4,6,8,13H,2,5H2;2H2,1H3 |
| InChIKey | ARXQFAVTLDUUAU-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 63.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.29 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(1H-indol-7-yl)propanenitrile;propanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1H-indol-7-yl)propanenitrile;propanenitrile?
The IUPAC name of 3-(1H-indol-7-yl)propanenitrile;propanenitrile (CID 157211357) is 3-(1H-indol-7-yl)propanenitrile;propanenitrile.
What is the SMILES notation for 3-(1H-indol-7-yl)propanenitrile;propanenitrile?
The canonical SMILES for 3-(1H-indol-7-yl)propanenitrile;propanenitrile is CCC#N.N#CCCc1cccc2cc[nH]c12.
What is the InChIKey of 3-(1H-indol-7-yl)propanenitrile;propanenitrile?
The InChIKey is ARXQFAVTLDUUAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10N2.C3H5N/c12-7-2-5-9-3-1-4-10-6-8-13-11(9)10;1-2-3-4/h1,3-4,6,8,13H,2,5H2;2H2,1H3.
What are the key properties of 3-(1H-indol-7-yl)propanenitrile;propanenitrile?
3-(1H-indol-7-yl)propanenitrile;propanenitrile has a molecular weight of 225.29 g/mol, XLogP of 3.54, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1H-indol-7-yl)propanenitrile;propanenitrile is sourced from PubChem (CID 157211357), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).