C16H9NO4 — CID 157211379
4,11-dihydroxy-3H-naphtho[2,3-f]indole-5,10-dione (PubChem CID 157211379) has the molecular formula C16H9NO4 and a molecular weight of 279.25 g/mol. Its IUPAC name is 4,11-dihydroxy-3H-naphtho[2,3-f]indole-5,10-dione.
| Compound Name | 4,11-dihydroxy-3H-naphtho[2,3-f]indole-5,10-dione |
|---|---|
| PubChem CID | 157211379 |
| Molecular Formula | C16H9NO4 |
| Molecular Weight | 279.25 g/mol |
| Exact Mass | 279.05 |
| IUPAC Name | 4,11-dihydroxy-3H-naphtho[2,3-f]indole-5,10-dione |
| SMILES | O=C1c2ccccc2C(=O)c2c(O)c3c(c(O)c21)CC=N3 |
| InChI | InChI=1S/C16H9NO4/c18-13-7-3-1-2-4-8(7)14(19)11-10(13)15(20)9-5-6-17-12(9)16(11)21/h1-4,6,20-21H,5H2 |
| InChIKey | GTKKGPRFJBCMKB-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 86.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.25 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|