C8H6Br2O3S — CID 15721378
2-(2,4-dibromophenyl)sulfinylacetic acid (PubChem CID 15721378) has the molecular formula C8H6Br2O3S and a molecular weight of 342.01 g/mol. Its IUPAC name is 2-(2,4-dibromophenyl)sulfinylacetic acid.
| Compound Name | 2-(2,4-dibromophenyl)sulfinylacetic acid |
|---|---|
| PubChem CID | 15721378 |
| Molecular Formula | C8H6Br2O3S |
| Molecular Weight | 342.01 g/mol |
| Exact Mass | 339.84 |
| IUPAC Name | 2-(2,4-dibromophenyl)sulfinylacetic acid |
| SMILES | O=C(O)CS(=O)c1ccc(Br)cc1Br |
| InChI | InChI=1S/C8H6Br2O3S/c9-5-1-2-7(6(10)3-5)14(13)4-8(11)12/h1-3H,4H2,(H,11,12) |
| InChIKey | XURLVPZEIAVEGL-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.01 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |