C32H34BClN8O4 — CID 157214130
4-(3-amino-5-morpholin-4-yl-2-pyridinyl)benzonitrile;2-chloro-5-morpholin-4-ylpyridin-3-amine;(4-cyanophenyl)boronic acid (PubChem CID 157214130) has the molecular formula C32H34BClN8O4 and a molecular weight of 640.94 g/mol. Its IUPAC name is 4-(3-amino-5-morpholin-4-yl-2-pyridinyl)benzonitrile;2-chloro-5-morpholin-4-ylpyridin-3-amine;(4-cyanophenyl)boronic acid.
| Compound Name | 4-(3-amino-5-morpholin-4-yl-2-pyridinyl)benzonitrile;2-chloro-5-morpholin-4-ylpyridin-3-amine;(4-cyanophenyl)boronic acid |
|---|---|
| PubChem CID | 157214130 |
| Molecular Formula | C32H34BClN8O4 |
| Molecular Weight | 640.94 g/mol |
| Exact Mass | 640.25 |
| IUPAC Name | 4-(3-amino-5-morpholin-4-yl-2-pyridinyl)benzonitrile;2-chloro-5-morpholin-4-ylpyridin-3-amine;(4-cyanophenyl)boronic acid |
| SMILES | N#Cc1ccc(-c2ncc(N3CCOCC3)cc2N)cc1.N#Cc1ccc(B(O)O)cc1.Nc1cc(N2CCOCC2)cnc1Cl |
| InChI | InChI=1S/C16H16N4O.C9H12ClN3O.C7H6BNO2/c17-10-12-1-3-13(4-2-12)16-15(18)9-14(11-19-16)20-5-7-21-8-6-20;10-9-8(11)5-7(6-12-9)13-1-3-14-4-2-13;9-5-6-1-3-7(4-2-6)8(10)11/h1-4,9,11H,5-8,18H2;5-6H,1-4,11H2;1-4,10-11H |
| InChIKey | ASFIFEIXIMZUOE-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 190.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.94 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|