C22H26O — CID 15721429
2-tert-butyl-7-ethoxy-4,5,9,10-tetrahydropyrene (PubChem CID 15721429) has the molecular formula C22H26O and a molecular weight of 306.45 g/mol. Its IUPAC name is 2-tert-butyl-7-ethoxy-4,5,9,10-tetrahydropyrene.
| Compound Name | 2-tert-butyl-7-ethoxy-4,5,9,10-tetrahydropyrene |
|---|---|
| PubChem CID | 15721429 |
| Molecular Formula | C22H26O |
| Molecular Weight | 306.45 g/mol |
| Exact Mass | 306.20 |
| IUPAC Name | 2-tert-butyl-7-ethoxy-4,5,9,10-tetrahydropyrene |
| SMILES | CCOc1cc2c3c(c1)CCc1cc(C(C)(C)C)cc(c1-3)CC2 |
| InChI | InChI=1S/C22H26O/c1-5-23-19-12-16-8-6-14-10-18(22(2,3)4)11-15-7-9-17(13-19)21(16)20(14)15/h10-13H,5-9H2,1-4H3 |
| InChIKey | NUWHVYHUDBRSCT-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.45 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |