C31H43B2N3O4 — CID 157214412
N,N-dimethyl-1-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indol-3-yl]methanamine;5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole (PubChem CID 157214412) has the molecular formula C31H43B2N3O4 and a molecular weight of 543.33 g/mol. Its IUPAC name is N,N-dimethyl-1-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indol-3-yl]methanamine;5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole.
| Compound Name | N,N-dimethyl-1-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indol-3-yl]methanamine;5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole |
|---|---|
| PubChem CID | 157214412 |
| Molecular Formula | C31H43B2N3O4 |
| Molecular Weight | 543.33 g/mol |
| Exact Mass | 543.34 |
| IUPAC Name | N,N-dimethyl-1-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indol-3-yl]methanamine;5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole |
| SMILES | CC1(C)OB(c2ccc3[nH]ccc3c2)OC1(C)C.CN(C)Cc1c[nH]c2ccc(B3OC(C)(C)C(C)(C)O3)cc12 |
| InChI | InChI=1S/C17H25BN2O2.C14H18BNO2/c1-16(2)17(3,4)22-18(21-16)13-7-8-15-14(9-13)12(10-19-15)11-20(5)6;1-13(2)14(3,4)18-15(17-13)11-5-6-12-10(9-11)7-8-16-12/h7-10,19H,11H2,1-6H3;5-9,16H,1-4H3 |
| InChIKey | ASGGADYEPBWZPS-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 71.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.33 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|