C41H50F2N4O — CID 157214534
4-[1-(1-adamantylmethyl)-2-[4-(dipropylamino)phenyl]benzimidazol-5-yl]-4-[(3,4-difluorophenyl)methylamino]butan-2-one (PubChem CID 157214534) has the molecular formula C41H50F2N4O and a molecular weight of 652.87 g/mol. Its IUPAC name is 4-[1-(1-adamantylmethyl)-2-[4-(dipropylamino)phenyl]benzimidazol-5-yl]-4-[(3,4-difluorophenyl)methylamino]butan-2-one.
| Compound Name | 4-[1-(1-adamantylmethyl)-2-[4-(dipropylamino)phenyl]benzimidazol-5-yl]-4-[(3,4-difluorophenyl)methylamino]butan-2-one |
|---|---|
| PubChem CID | 157214534 |
| Molecular Formula | C41H50F2N4O |
| Molecular Weight | 652.87 g/mol |
| Exact Mass | 652.40 |
| IUPAC Name | 4-[1-(1-adamantylmethyl)-2-[4-(dipropylamino)phenyl]benzimidazol-5-yl]-4-[(3,4-difluorophenyl)methylamino]butan-2-one |
| SMILES | CCCN(CCC)c1ccc(-c2nc3cc(C(CC(C)=O)NCc4ccc(F)c(F)c4)ccc3n2CC23CC4CC(CC(C4)C2)C3)cc1 |
| InChI | InChI=1S/C41H50F2N4O/c1-4-14-46(15-5-2)34-10-7-32(8-11-34)40-45-38-21-33(37(16-27(3)48)44-25-28-6-12-35(42)36(43)20-28)9-13-39(38)47(40)26-41-22-29-17-30(23-41)19-31(18-29)24-41/h6-13,20-21,29-31,37,44H,4-5,14-19,22-26H2,1-3H3 |
| InChIKey | URSPSZAZYDNABQ-UHFFFAOYSA-N |
| XLogP | 9.63 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.87 |
| LogP ≤ 5 | 9.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_G(9)', 'substructure': 'N/A'} |
|---|