About 2-[(4-aminophenyl)methylidene]propanedioate;chloromethane;ethane
2-[(4-aminophenyl)methylidene]propanedioate;chloromethane;ethane (PubChem CID 157215515) has the molecular formula C13H16ClNO4-2
and a molecular weight of 285.73 g/mol. Its IUPAC name is 2-[(4-aminophenyl)methylidene]propanedioate;chloromethane;ethane.
Molecular Properties
| Compound Name | 2-[(4-aminophenyl)methylidene]propanedioate;chloromethane;ethane |
| PubChem CID | 157215515 |
| Molecular Formula | C13H16ClNO4-2 |
| Molecular Weight | 285.73 g/mol |
| Exact Mass | 285.08 |
| IUPAC Name | 2-[(4-aminophenyl)methylidene]propanedioate;chloromethane;ethane |
| SMILES | CC.CCl.Nc1ccc(C=C(C(=O)[O-])C(=O)[O-])cc1 |
| InChI | InChI=1S/C10H9NO4.C2H6.CH3Cl/c11-7-3-1-6(2-4-7)5-8(9(12)13)10(14)15;2*1-2/h1-5H,11H2,(H,12,13)(H,14,15);1-2H3;1H3/p-2 |
| InChIKey | ASJFXVXZBKGSFC-UHFFFAOYSA-L |
| XLogP | 0.03 |
| TPSA | 106.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.73 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|
Analyze 2-[(4-aminophenyl)methylidene]propanedioate;chloromethane;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(4-aminophenyl)methylidene]propanedioate;chloromethane;ethane?
The IUPAC name of 2-[(4-aminophenyl)methylidene]propanedioate;chloromethane;ethane (CID 157215515) is 2-[(4-aminophenyl)methylidene]propanedioate;chloromethane;ethane.
What is the SMILES notation for 2-[(4-aminophenyl)methylidene]propanedioate;chloromethane;ethane?
The canonical SMILES for 2-[(4-aminophenyl)methylidene]propanedioate;chloromethane;ethane is CC.CCl.Nc1ccc(C=C(C(=O)[O-])C(=O)[O-])cc1.
What is the InChIKey of 2-[(4-aminophenyl)methylidene]propanedioate;chloromethane;ethane?
The InChIKey is ASJFXVXZBKGSFC-UHFFFAOYSA-L. The full InChI is InChI=1S/C10H9NO4.C2H6.CH3Cl/c11-7-3-1-6(2-4-7)5-8(9(12)13)10(14)15;2*1-2/h1-5H,11H2,(H,12,13)(H,14,15);1-2H3;1H3/p-2.
What are the key properties of 2-[(4-aminophenyl)methylidene]propanedioate;chloromethane;ethane?
2-[(4-aminophenyl)methylidene]propanedioate;chloromethane;ethane has a molecular weight of 285.73 g/mol, XLogP of 0.03, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4-aminophenyl)methylidene]propanedioate;chloromethane;ethane is sourced from PubChem (CID 157215515), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).