About 1-iodo-4-(2-methylbutan-2-yl)benzene;(4-methylphenyl) sulfate
1-iodo-4-(2-methylbutan-2-yl)benzene;(4-methylphenyl) sulfate (PubChem CID 157216374) has the molecular formula C18H22IO4S-
and a molecular weight of 461.34 g/mol. Its IUPAC name is 1-iodo-4-(2-methylbutan-2-yl)benzene;(4-methylphenyl) sulfate.
Molecular Properties
| Compound Name | 1-iodo-4-(2-methylbutan-2-yl)benzene;(4-methylphenyl) sulfate |
| PubChem CID | 157216374 |
| Molecular Formula | C18H22IO4S- |
| Molecular Weight | 461.34 g/mol |
| Exact Mass | 461.03 |
| IUPAC Name | 1-iodo-4-(2-methylbutan-2-yl)benzene;(4-methylphenyl) sulfate |
| SMILES | CCC(C)(C)c1ccc(I)cc1.Cc1ccc(OS(=O)(=O)[O-])cc1 |
| InChI | InChI=1S/C11H15I.C7H8O4S/c1-4-11(2,3)9-5-7-10(12)8-6-9;1-6-2-4-7(5-3-6)11-12(8,9)10/h5-8H,4H2,1-3H3;2-5H,1H3,(H,8,9,10)/p-1 |
| InChIKey | ASLSGOOWGRJLRF-UHFFFAOYSA-M |
| XLogP | 4.81 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 461.34 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|
Analyze 1-iodo-4-(2-methylbutan-2-yl)benzene;(4-methylphenyl) sulfate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-iodo-4-(2-methylbutan-2-yl)benzene;(4-methylphenyl) sulfate?
The IUPAC name of 1-iodo-4-(2-methylbutan-2-yl)benzene;(4-methylphenyl) sulfate (CID 157216374) is 1-iodo-4-(2-methylbutan-2-yl)benzene;(4-methylphenyl) sulfate.
What is the SMILES notation for 1-iodo-4-(2-methylbutan-2-yl)benzene;(4-methylphenyl) sulfate?
The canonical SMILES for 1-iodo-4-(2-methylbutan-2-yl)benzene;(4-methylphenyl) sulfate is CCC(C)(C)c1ccc(I)cc1.Cc1ccc(OS(=O)(=O)[O-])cc1.
What is the InChIKey of 1-iodo-4-(2-methylbutan-2-yl)benzene;(4-methylphenyl) sulfate?
The InChIKey is ASLSGOOWGRJLRF-UHFFFAOYSA-M. The full InChI is InChI=1S/C11H15I.C7H8O4S/c1-4-11(2,3)9-5-7-10(12)8-6-9;1-6-2-4-7(5-3-6)11-12(8,9)10/h5-8H,4H2,1-3H3;2-5H,1H3,(H,8,9,10)/p-1.
What are the key properties of 1-iodo-4-(2-methylbutan-2-yl)benzene;(4-methylphenyl) sulfate?
1-iodo-4-(2-methylbutan-2-yl)benzene;(4-methylphenyl) sulfate has a molecular weight of 461.34 g/mol, XLogP of 4.81, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-iodo-4-(2-methylbutan-2-yl)benzene;(4-methylphenyl) sulfate is sourced from PubChem (CID 157216374), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).