About chlorosilane;trichlorosilane
chlorosilane;trichlorosilane (PubChem CID 157218130) has the molecular formula H4Cl4Si2
and a molecular weight of 202.02 g/mol. Its IUPAC name is chlorosilane;trichlorosilane.
Molecular Properties
| Compound Name | chlorosilane;trichlorosilane |
| PubChem CID | 157218130 |
| Molecular Formula | H4Cl4Si2 |
| Molecular Weight | 202.02 g/mol |
| Exact Mass | 199.86 |
| IUPAC Name | chlorosilane;trichlorosilane |
| SMILES | Cl[SiH](Cl)Cl.[SiH3]Cl |
| InChI | InChI=1S/Cl3HSi.ClH3Si/c1-4(2)3;1-2/h4H;2H3 |
| InChIKey | ASQUUIVTXSTILE-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.02 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|
Analyze chlorosilane;trichlorosilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chlorosilane;trichlorosilane?
The IUPAC name of chlorosilane;trichlorosilane (CID 157218130) is chlorosilane;trichlorosilane.
What is the SMILES notation for chlorosilane;trichlorosilane?
The canonical SMILES for chlorosilane;trichlorosilane is Cl[SiH](Cl)Cl.[SiH3]Cl.
What is the InChIKey of chlorosilane;trichlorosilane?
The InChIKey is ASQUUIVTXSTILE-UHFFFAOYSA-N. The full InChI is InChI=1S/Cl3HSi.ClH3Si/c1-4(2)3;1-2/h4H;2H3.
What are the key properties of chlorosilane;trichlorosilane?
chlorosilane;trichlorosilane has a molecular weight of 202.02 g/mol, XLogP of 0.93, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for chlorosilane;trichlorosilane is sourced from PubChem (CID 157218130), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).