C30H33NO5S — CID 157218637
3,5-bis[(4-hydroxy-2,5-dimethylphenyl)methyl]benzenesulfonamide;phenol (PubChem CID 157218637) has the molecular formula C30H33NO5S and a molecular weight of 519.66 g/mol. Its IUPAC name is 3,5-bis[(4-hydroxy-2,5-dimethylphenyl)methyl]benzenesulfonamide;phenol.
| Compound Name | 3,5-bis[(4-hydroxy-2,5-dimethylphenyl)methyl]benzenesulfonamide;phenol |
|---|---|
| PubChem CID | 157218637 |
| Molecular Formula | C30H33NO5S |
| Molecular Weight | 519.66 g/mol |
| Exact Mass | 519.21 |
| IUPAC Name | 3,5-bis[(4-hydroxy-2,5-dimethylphenyl)methyl]benzenesulfonamide;phenol |
| SMILES | Cc1cc(Cc2cc(Cc3cc(C)c(O)cc3C)cc(S(N)(=O)=O)c2)c(C)cc1O.Oc1ccccc1 |
| InChI | InChI=1S/C24H27NO4S.C6H6O/c1-14-7-23(26)16(3)5-20(14)10-18-9-19(13-22(12-18)30(25,28)29)11-21-6-17(4)24(27)8-15(21)2;7-6-4-2-1-3-5-6/h5-9,12-13,26-27H,10-11H2,1-4H3,(H2,25,28,29);1-5,7H |
| InChIKey | ASSGSIZLZFYGBX-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 120.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.66 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |