About 1-ethylimidazole-4,5-dicarbonitrile
1-ethylimidazole-4,5-dicarbonitrile (PubChem CID 15721926) has the molecular formula C7H6N4
and a molecular weight of 146.15 g/mol. Its IUPAC name is 1-ethylimidazole-4,5-dicarbonitrile.
Molecular Properties
| Compound Name | 1-ethylimidazole-4,5-dicarbonitrile |
| PubChem CID | 15721926 |
| Molecular Formula | C7H6N4 |
| Molecular Weight | 146.15 g/mol |
| Exact Mass | 146.06 |
| IUPAC Name | 1-ethylimidazole-4,5-dicarbonitrile |
| SMILES | CCn1cnc(C#N)c1C#N |
| InChI | InChI=1S/C7H6N4/c1-2-11-5-10-6(3-8)7(11)4-9/h5H,2H2,1H3 |
| InChIKey | RAFSTXGDSLCINC-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 65.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.15 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-ethylimidazole-4,5-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethylimidazole-4,5-dicarbonitrile?
The IUPAC name of 1-ethylimidazole-4,5-dicarbonitrile (CID 15721926) is 1-ethylimidazole-4,5-dicarbonitrile.
What is the SMILES notation for 1-ethylimidazole-4,5-dicarbonitrile?
The canonical SMILES for 1-ethylimidazole-4,5-dicarbonitrile is CCn1cnc(C#N)c1C#N.
What is the InChIKey of 1-ethylimidazole-4,5-dicarbonitrile?
The InChIKey is RAFSTXGDSLCINC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6N4/c1-2-11-5-10-6(3-8)7(11)4-9/h5H,2H2,1H3.
What are the key properties of 1-ethylimidazole-4,5-dicarbonitrile?
1-ethylimidazole-4,5-dicarbonitrile has a molecular weight of 146.15 g/mol, XLogP of 0.65, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethylimidazole-4,5-dicarbonitrile is sourced from PubChem (CID 15721926), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).