About adamantane;1-azabicyclo[2.2.2]octane;spiro[2.5]oct-6-ene
adamantane;1-azabicyclo[2.2.2]octane;spiro[2.5]oct-6-ene (PubChem CID 157220030) has the molecular formula C25H41N
and a molecular weight of 355.61 g/mol. Its IUPAC name is adamantane;1-azabicyclo[2.2.2]octane;spiro[2.5]oct-6-ene.
Molecular Properties
| Compound Name | adamantane;1-azabicyclo[2.2.2]octane;spiro[2.5]oct-6-ene |
| PubChem CID | 157220030 |
| Molecular Formula | C25H41N |
| Molecular Weight | 355.61 g/mol |
| Exact Mass | 355.32 |
| IUPAC Name | adamantane;1-azabicyclo[2.2.2]octane;spiro[2.5]oct-6-ene |
| SMILES | C1=CCC2(CC1)CC2.C1C2CC3CC1CC(C2)C3.C1CN2CCC1CC2 |
| InChI | InChI=1S/C10H16.C8H12.C7H13N/c1-7-2-9-4-8(1)5-10(3-7)6-9;1-2-4-8(5-3-1)6-7-8;1-4-8-5-2-7(1)3-6-8/h7-10H,1-6H2;1-2H,3-7H2;7H,1-6H2 |
| InChIKey | ASWIGHVKHCAWEN-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 355.61 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze adamantane;1-azabicyclo[2.2.2]octane;spiro[2.5]oct-6-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of adamantane;1-azabicyclo[2.2.2]octane;spiro[2.5]oct-6-ene?
The IUPAC name of adamantane;1-azabicyclo[2.2.2]octane;spiro[2.5]oct-6-ene (CID 157220030) is adamantane;1-azabicyclo[2.2.2]octane;spiro[2.5]oct-6-ene.
What is the SMILES notation for adamantane;1-azabicyclo[2.2.2]octane;spiro[2.5]oct-6-ene?
The canonical SMILES for adamantane;1-azabicyclo[2.2.2]octane;spiro[2.5]oct-6-ene is C1=CCC2(CC1)CC2.C1C2CC3CC1CC(C2)C3.C1CN2CCC1CC2.
What is the InChIKey of adamantane;1-azabicyclo[2.2.2]octane;spiro[2.5]oct-6-ene?
The InChIKey is ASWIGHVKHCAWEN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16.C8H12.C7H13N/c1-7-2-9-4-8(1)5-10(3-7)6-9;1-2-4-8(5-3-1)6-7-8;1-4-8-5-2-7(1)3-6-8/h7-10H,1-6H2;1-2H,3-7H2;7H,1-6H2.
What are the key properties of adamantane;1-azabicyclo[2.2.2]octane;spiro[2.5]oct-6-ene?
adamantane;1-azabicyclo[2.2.2]octane;spiro[2.5]oct-6-ene has a molecular weight of 355.61 g/mol, XLogP of 6.44, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for adamantane;1-azabicyclo[2.2.2]octane;spiro[2.5]oct-6-ene is sourced from PubChem (CID 157220030), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).