About 3-benzylquinoline;3-benzylquinoline-4-carboxylic acid;ethane
3-benzylquinoline;3-benzylquinoline-4-carboxylic acid;ethane (PubChem CID 157220353) has the molecular formula C41H50N2O2
and a molecular weight of 602.86 g/mol. Its IUPAC name is 3-benzylquinoline;3-benzylquinoline-4-carboxylic acid;ethane.
Molecular Properties
| Compound Name | 3-benzylquinoline;3-benzylquinoline-4-carboxylic acid;ethane |
| PubChem CID | 157220353 |
| Molecular Formula | C41H50N2O2 |
| Molecular Weight | 602.86 g/mol |
| Exact Mass | 602.39 |
| IUPAC Name | 3-benzylquinoline;3-benzylquinoline-4-carboxylic acid;ethane |
| SMILES | CC.CC.CC.CC.O=C(O)c1c(Cc2ccccc2)cnc2ccccc12.c1ccc(Cc2cnc3ccccc3c2)cc1 |
| InChI | InChI=1S/C17H13NO2.C16H13N.4C2H6/c19-17(20)16-13(10-12-6-2-1-3-7-12)11-18-15-9-5-4-8-14(15)16;1-2-6-13(7-3-1)10-14-11-15-8-4-5-9-16(15)17-12-14;4*1-2/h1-9,11H,10H2,(H,19,20);1-9,11-12H,10H2;4*1-2H3 |
| InChIKey | ASXJLVFGGVKFFH-UHFFFAOYSA-N |
| XLogP | 11.45 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 602.86 |
| LogP ≤ 5 | 11.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-benzylquinoline;3-benzylquinoline-4-carboxylic acid;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-benzylquinoline;3-benzylquinoline-4-carboxylic acid;ethane?
The IUPAC name of 3-benzylquinoline;3-benzylquinoline-4-carboxylic acid;ethane (CID 157220353) is 3-benzylquinoline;3-benzylquinoline-4-carboxylic acid;ethane.
What is the SMILES notation for 3-benzylquinoline;3-benzylquinoline-4-carboxylic acid;ethane?
The canonical SMILES for 3-benzylquinoline;3-benzylquinoline-4-carboxylic acid;ethane is CC.CC.CC.CC.O=C(O)c1c(Cc2ccccc2)cnc2ccccc12.c1ccc(Cc2cnc3ccccc3c2)cc1.
What is the InChIKey of 3-benzylquinoline;3-benzylquinoline-4-carboxylic acid;ethane?
The InChIKey is ASXJLVFGGVKFFH-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H13NO2.C16H13N.4C2H6/c19-17(20)16-13(10-12-6-2-1-3-7-12)11-18-15-9-5-4-8-14(15)16;1-2-6-13(7-3-1)10-14-11-15-8-4-5-9-16(15)17-12-14;4*1-2/h1-9,11H,10H2,(H,19,20);1-9,11-12H,10H2;4*1-2H3.
What are the key properties of 3-benzylquinoline;3-benzylquinoline-4-carboxylic acid;ethane?
3-benzylquinoline;3-benzylquinoline-4-carboxylic acid;ethane has a molecular weight of 602.86 g/mol, XLogP of 11.45, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-benzylquinoline;3-benzylquinoline-4-carboxylic acid;ethane is sourced from PubChem (CID 157220353), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).