About 2-(2-fluorophenyl)-1,3-oxathiane
2-(2-fluorophenyl)-1,3-oxathiane (PubChem CID 15722051) has the molecular formula C10H11FOS
and a molecular weight of 198.26 g/mol. Its IUPAC name is 2-(2-fluorophenyl)-1,3-oxathiane.
Molecular Properties
| Compound Name | 2-(2-fluorophenyl)-1,3-oxathiane |
| PubChem CID | 15722051 |
| Molecular Formula | C10H11FOS |
| Molecular Weight | 198.26 g/mol |
| Exact Mass | 198.05 |
| IUPAC Name | 2-(2-fluorophenyl)-1,3-oxathiane |
| SMILES | Fc1ccccc1C1OCCCS1 |
| InChI | InChI=1S/C10H11FOS/c11-9-5-2-1-4-8(9)10-12-6-3-7-13-10/h1-2,4-5,10H,3,6-7H2 |
| InChIKey | IQGUEIWTRAWSFK-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.26 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(2-fluorophenyl)-1,3-oxathiane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-fluorophenyl)-1,3-oxathiane?
The IUPAC name of 2-(2-fluorophenyl)-1,3-oxathiane (CID 15722051) is 2-(2-fluorophenyl)-1,3-oxathiane.
What is the SMILES notation for 2-(2-fluorophenyl)-1,3-oxathiane?
The canonical SMILES for 2-(2-fluorophenyl)-1,3-oxathiane is Fc1ccccc1C1OCCCS1.
What is the InChIKey of 2-(2-fluorophenyl)-1,3-oxathiane?
The InChIKey is IQGUEIWTRAWSFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11FOS/c11-9-5-2-1-4-8(9)10-12-6-3-7-13-10/h1-2,4-5,10H,3,6-7H2.
What are the key properties of 2-(2-fluorophenyl)-1,3-oxathiane?
2-(2-fluorophenyl)-1,3-oxathiane has a molecular weight of 198.26 g/mol, XLogP of 2.98, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-fluorophenyl)-1,3-oxathiane is sourced from PubChem (CID 15722051), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).