C23H24ClN3O2S — CID 157220839
1-[6-[5-(6-chloro-2-pyridinyl)-5-methyl-4H-1,2-thiazol-3-yl]spiro[1H-2-benzofuran-3,3'-azetidine]-1'-yl]-2-methylpropan-1-one (PubChem CID 157220839) has the molecular formula C23H24ClN3O2S and a molecular weight of 441.98 g/mol. Its IUPAC name is 1-[6-[5-(6-chloro-2-pyridinyl)-5-methyl-4H-1,2-thiazol-3-yl]spiro[1H-2-benzofuran-3,3'-azetidine]-1'-yl]-2-methylpropan-1-one.
| Compound Name | 1-[6-[5-(6-chloro-2-pyridinyl)-5-methyl-4H-1,2-thiazol-3-yl]spiro[1H-2-benzofuran-3,3'-azetidine]-1'-yl]-2-methylpropan-1-one |
|---|---|
| PubChem CID | 157220839 |
| Molecular Formula | C23H24ClN3O2S |
| Molecular Weight | 441.98 g/mol |
| Exact Mass | 441.13 |
| IUPAC Name | 1-[6-[5-(6-chloro-2-pyridinyl)-5-methyl-4H-1,2-thiazol-3-yl]spiro[1H-2-benzofuran-3,3'-azetidine]-1'-yl]-2-methylpropan-1-one |
| SMILES | CC(C)C(=O)N1CC2(C1)OCc1cc(C3=NSC(C)(c4cccc(Cl)n4)C3)ccc12 |
| InChI | InChI=1S/C23H24ClN3O2S/c1-14(2)21(28)27-12-23(13-27)17-8-7-15(9-16(17)11-29-23)18-10-22(3,30-26-18)19-5-4-6-20(24)25-19/h4-9,14H,10-13H2,1-3H3 |
| InChIKey | ASYXVVVAKAAVOF-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 54.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.98 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|