About 8-fluoro-2,5,6-tri(propan-2-yl)-2-azabicyclo[2.2.2]octane
8-fluoro-2,5,6-tri(propan-2-yl)-2-azabicyclo[2.2.2]octane (PubChem CID 157221735) has the molecular formula C16H30FN
and a molecular weight of 255.42 g/mol. Its IUPAC name is 8-fluoro-2,5,6-tri(propan-2-yl)-2-azabicyclo[2.2.2]octane.
Molecular Properties
| Compound Name | 8-fluoro-2,5,6-tri(propan-2-yl)-2-azabicyclo[2.2.2]octane |
| PubChem CID | 157221735 |
| Molecular Formula | C16H30FN |
| Molecular Weight | 255.42 g/mol |
| Exact Mass | 255.24 |
| IUPAC Name | 8-fluoro-2,5,6-tri(propan-2-yl)-2-azabicyclo[2.2.2]octane |
| SMILES | CC(C)C1C2CN(C(C)C)C(CC2F)C1C(C)C |
| InChI | InChI=1S/C16H30FN/c1-9(2)15-12-8-18(11(5)6)14(7-13(12)17)16(15)10(3)4/h9-16H,7-8H2,1-6H3 |
| InChIKey | RPSBJVBWUZZTFH-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.42 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 8-fluoro-2,5,6-tri(propan-2-yl)-2-azabicyclo[2.2.2]octane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-fluoro-2,5,6-tri(propan-2-yl)-2-azabicyclo[2.2.2]octane?
The IUPAC name of 8-fluoro-2,5,6-tri(propan-2-yl)-2-azabicyclo[2.2.2]octane (CID 157221735) is 8-fluoro-2,5,6-tri(propan-2-yl)-2-azabicyclo[2.2.2]octane.
What is the SMILES notation for 8-fluoro-2,5,6-tri(propan-2-yl)-2-azabicyclo[2.2.2]octane?
The canonical SMILES for 8-fluoro-2,5,6-tri(propan-2-yl)-2-azabicyclo[2.2.2]octane is CC(C)C1C2CN(C(C)C)C(CC2F)C1C(C)C.
What is the InChIKey of 8-fluoro-2,5,6-tri(propan-2-yl)-2-azabicyclo[2.2.2]octane?
The InChIKey is RPSBJVBWUZZTFH-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H30FN/c1-9(2)15-12-8-18(11(5)6)14(7-13(12)17)16(15)10(3)4/h9-16H,7-8H2,1-6H3.
What are the key properties of 8-fluoro-2,5,6-tri(propan-2-yl)-2-azabicyclo[2.2.2]octane?
8-fluoro-2,5,6-tri(propan-2-yl)-2-azabicyclo[2.2.2]octane has a molecular weight of 255.42 g/mol, XLogP of 3.98, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 8-fluoro-2,5,6-tri(propan-2-yl)-2-azabicyclo[2.2.2]octane is sourced from PubChem (CID 157221735), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).