C30H29N3O2 — CID 157223690
N-[[4-(dimethylamino)phenyl]methyl]-3-[(1R,2R)-2-(2-isoquinolin-6-ylacetyl)cyclopropyl]benzamide (PubChem CID 157223690) has the molecular formula C30H29N3O2 and a molecular weight of 463.58 g/mol. Its IUPAC name is N-[[4-(dimethylamino)phenyl]methyl]-3-[(1R,2R)-2-(2-isoquinolin-6-ylacetyl)cyclopropyl]benzamide.
| Compound Name | N-[[4-(dimethylamino)phenyl]methyl]-3-[(1R,2R)-2-(2-isoquinolin-6-ylacetyl)cyclopropyl]benzamide |
|---|---|
| PubChem CID | 157223690 |
| Molecular Formula | C30H29N3O2 |
| Molecular Weight | 463.58 g/mol |
| Exact Mass | 463.23 |
| IUPAC Name | N-[[4-(dimethylamino)phenyl]methyl]-3-[(1R,2R)-2-(2-isoquinolin-6-ylacetyl)cyclopropyl]benzamide |
| SMILES | CN(C)c1ccc(CNC(=O)c2cccc([C@@H]3C[C@H]3C(=O)Cc3ccc4cnccc4c3)c2)cc1 |
| InChI | InChI=1S/C30H29N3O2/c1-33(2)26-10-7-20(8-11-26)18-32-30(35)24-5-3-4-23(16-24)27-17-28(27)29(34)15-21-6-9-25-19-31-13-12-22(25)14-21/h3-14,16,19,27-28H,15,17-18H2,1-2H3,(H,32,35)/t27-,28+/m0/s1 |
| InChIKey | ATHGYZKERZPRFV-WUFINQPMSA-N |
| XLogP | 5.15 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.58 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|