About CID 15722406
CID 15722406 (PubChem CID 15722406) has the molecular formula C2H6N3Se
and a molecular weight of 151.05 g/mol.
Molecular Properties
| Compound Name | CID 15722406 |
| PubChem CID | 15722406 |
| Molecular Formula | C2H6N3Se |
| Molecular Weight | 151.05 g/mol |
| Exact Mass | 151.97 |
| IUPAC Name | — |
| SMILES | [H]/N=C(\[Se])N(C)N |
| InChI | InChI=1S/C2H6N3Se/c1-5(4)2(3)6/h3H,4H2,1H3/b3-2- |
| InChIKey | FCXNUDQKUDZEFJ-IHWYPQMZSA-N |
| XLogP | -1.10 |
| TPSA | 53.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.05 |
| LogP ≤ 5 | -1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze CID 15722406 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 15722406?
The IUPAC name of CID 15722406 (CID 15722406) is not available.
What is the SMILES notation for CID 15722406?
The canonical SMILES for CID 15722406 is [H]/N=C(\[Se])N(C)N.
What is the InChIKey of CID 15722406?
The InChIKey is FCXNUDQKUDZEFJ-IHWYPQMZSA-N. The full InChI is InChI=1S/C2H6N3Se/c1-5(4)2(3)6/h3H,4H2,1H3/b3-2-.
What are the key properties of CID 15722406?
CID 15722406 has a molecular weight of 151.05 g/mol, XLogP of -1.10, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 15722406 is sourced from PubChem (CID 15722406), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).