About 1-(4,5-diphenyl-1,3-selenazol-2-yl)-1-methylhydrazine
1-(4,5-diphenyl-1,3-selenazol-2-yl)-1-methylhydrazine (PubChem CID 15722408) has the molecular formula C16H15N3Se
and a molecular weight of 328.28 g/mol. Its IUPAC name is 1-(4,5-diphenyl-1,3-selenazol-2-yl)-1-methylhydrazine.
Molecular Properties
| Compound Name | 1-(4,5-diphenyl-1,3-selenazol-2-yl)-1-methylhydrazine |
| PubChem CID | 15722408 |
| Molecular Formula | C16H15N3Se |
| Molecular Weight | 328.28 g/mol |
| Exact Mass | 329.04 |
| IUPAC Name | 1-(4,5-diphenyl-1,3-selenazol-2-yl)-1-methylhydrazine |
| SMILES | CN(N)c1nc(-c2ccccc2)c(-c2ccccc2)[se]1 |
| InChI | InChI=1S/C16H15N3Se/c1-19(17)16-18-14(12-8-4-2-5-9-12)15(20-16)13-10-6-3-7-11-13/h2-11H,17H2,1H3 |
| InChIKey | LKSOWYUMWHMAOM-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.28 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-(4,5-diphenyl-1,3-selenazol-2-yl)-1-methylhydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4,5-diphenyl-1,3-selenazol-2-yl)-1-methylhydrazine?
The IUPAC name of 1-(4,5-diphenyl-1,3-selenazol-2-yl)-1-methylhydrazine (CID 15722408) is 1-(4,5-diphenyl-1,3-selenazol-2-yl)-1-methylhydrazine.
What is the SMILES notation for 1-(4,5-diphenyl-1,3-selenazol-2-yl)-1-methylhydrazine?
The canonical SMILES for 1-(4,5-diphenyl-1,3-selenazol-2-yl)-1-methylhydrazine is CN(N)c1nc(-c2ccccc2)c(-c2ccccc2)[se]1.
What is the InChIKey of 1-(4,5-diphenyl-1,3-selenazol-2-yl)-1-methylhydrazine?
The InChIKey is LKSOWYUMWHMAOM-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15N3Se/c1-19(17)16-18-14(12-8-4-2-5-9-12)15(20-16)13-10-6-3-7-11-13/h2-11H,17H2,1H3.
What are the key properties of 1-(4,5-diphenyl-1,3-selenazol-2-yl)-1-methylhydrazine?
1-(4,5-diphenyl-1,3-selenazol-2-yl)-1-methylhydrazine has a molecular weight of 328.28 g/mol, XLogP of 2.78, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4,5-diphenyl-1,3-selenazol-2-yl)-1-methylhydrazine is sourced from PubChem (CID 15722408), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).