About formic acid;5-(6-piperazin-1-ylindazol-1-yl)sulfonyl-4H-1,4-benzoxazin-3-one
formic acid;5-(6-piperazin-1-ylindazol-1-yl)sulfonyl-4H-1,4-benzoxazin-3-one (PubChem CID 157225376) has the molecular formula C20H21N5O6S
and a molecular weight of 459.48 g/mol. Its IUPAC name is formic acid;5-(6-piperazin-1-ylindazol-1-yl)sulfonyl-4H-1,4-benzoxazin-3-one.
Molecular Properties
| Compound Name | formic acid;5-(6-piperazin-1-ylindazol-1-yl)sulfonyl-4H-1,4-benzoxazin-3-one |
| PubChem CID | 157225376 |
| Molecular Formula | C20H21N5O6S |
| Molecular Weight | 459.48 g/mol |
| Exact Mass | 459.12 |
| IUPAC Name | formic acid;5-(6-piperazin-1-ylindazol-1-yl)sulfonyl-4H-1,4-benzoxazin-3-one |
| SMILES | O=C1COc2cccc(S(=O)(=O)n3ncc4ccc(N5CCNCC5)cc43)c2N1.O=CO |
| InChI | InChI=1S/C19H19N5O4S.CH2O2/c25-18-12-28-16-2-1-3-17(19(16)22-18)29(26,27)24-15-10-14(5-4-13(15)11-21-24)23-8-6-20-7-9-23;2-1-3/h1-5,10-11,20H,6-9,12H2,(H,22,25);1H,(H,2,3) |
| InChIKey | ATLYQPFBMIQDSL-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 142.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 459.48 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze formic acid;5-(6-piperazin-1-ylindazol-1-yl)sulfonyl-4H-1,4-benzoxazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of formic acid;5-(6-piperazin-1-ylindazol-1-yl)sulfonyl-4H-1,4-benzoxazin-3-one?
The IUPAC name of formic acid;5-(6-piperazin-1-ylindazol-1-yl)sulfonyl-4H-1,4-benzoxazin-3-one (CID 157225376) is formic acid;5-(6-piperazin-1-ylindazol-1-yl)sulfonyl-4H-1,4-benzoxazin-3-one.
What is the SMILES notation for formic acid;5-(6-piperazin-1-ylindazol-1-yl)sulfonyl-4H-1,4-benzoxazin-3-one?
The canonical SMILES for formic acid;5-(6-piperazin-1-ylindazol-1-yl)sulfonyl-4H-1,4-benzoxazin-3-one is O=C1COc2cccc(S(=O)(=O)n3ncc4ccc(N5CCNCC5)cc43)c2N1.O=CO.
What is the InChIKey of formic acid;5-(6-piperazin-1-ylindazol-1-yl)sulfonyl-4H-1,4-benzoxazin-3-one?
The InChIKey is ATLYQPFBMIQDSL-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H19N5O4S.CH2O2/c25-18-12-28-16-2-1-3-17(19(16)22-18)29(26,27)24-15-10-14(5-4-13(15)11-21-24)23-8-6-20-7-9-23;2-1-3/h1-5,10-11,20H,6-9,12H2,(H,22,25);1H,(H,2,3).
What are the key properties of formic acid;5-(6-piperazin-1-ylindazol-1-yl)sulfonyl-4H-1,4-benzoxazin-3-one?
formic acid;5-(6-piperazin-1-ylindazol-1-yl)sulfonyl-4H-1,4-benzoxazin-3-one has a molecular weight of 459.48 g/mol, XLogP of 0.71, 3 rotatable bonds, 3 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for formic acid;5-(6-piperazin-1-ylindazol-1-yl)sulfonyl-4H-1,4-benzoxazin-3-one is sourced from PubChem (CID 157225376), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).