C20H21N5O6S — CID 157225376
formic acid;5-(6-piperazin-1-ylindazol-1-yl)sulfonyl-4H-1,4-benzoxazin-3-one (PubChem CID 157225376) has the molecular formula C20H21N5O6S and a molecular weight of 459.48 g/mol. Its IUPAC name is formic acid;5-(6-piperazin-1-ylindazol-1-yl)sulfonyl-4H-1,4-benzoxazin-3-one.
| Compound Name | formic acid;5-(6-piperazin-1-ylindazol-1-yl)sulfonyl-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 157225376 |
| Molecular Formula | C20H21N5O6S |
| Molecular Weight | 459.48 g/mol |
| Exact Mass | 459.12 |
| IUPAC Name | formic acid;5-(6-piperazin-1-ylindazol-1-yl)sulfonyl-4H-1,4-benzoxazin-3-one |
| SMILES | O=C1COc2cccc(S(=O)(=O)n3ncc4ccc(N5CCNCC5)cc43)c2N1.O=CO |
| InChI | InChI=1S/C19H19N5O4S.CH2O2/c25-18-12-28-16-2-1-3-17(19(16)22-18)29(26,27)24-15-10-14(5-4-13(15)11-21-24)23-8-6-20-7-9-23;2-1-3/h1-5,10-11,20H,6-9,12H2,(H,22,25);1H,(H,2,3) |
| InChIKey | ATLYQPFBMIQDSL-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 142.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.48 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|