C14H26OSi — CID 15722617
(5R,6R,7Z)-2,6-dimethyl-6-trimethylsilylnona-2,3,7-trien-5-ol (PubChem CID 15722617) has the molecular formula C14H26OSi and a molecular weight of 238.45 g/mol. Its IUPAC name is (5R,6R,7Z)-2,6-dimethyl-6-trimethylsilylnona-2,3,7-trien-5-ol.
| Compound Name | (5R,6R,7Z)-2,6-dimethyl-6-trimethylsilylnona-2,3,7-trien-5-ol |
|---|---|
| PubChem CID | 15722617 |
| Molecular Formula | C14H26OSi |
| Molecular Weight | 238.45 g/mol |
| Exact Mass | 238.18 |
| IUPAC Name | (5R,6R,7Z)-2,6-dimethyl-6-trimethylsilylnona-2,3,7-trien-5-ol |
| SMILES | C/C=C\[C@](C)([C@H](O)C=C=C(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C14H26OSi/c1-8-11-14(4,16(5,6)7)13(15)10-9-12(2)3/h8,10-11,13,15H,1-7H3/b11-8-/t13-,14-/m1/s1 |
| InChIKey | BRPPYRKMYNUOFV-RDNHTORASA-N |
| XLogP | 4.14 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.45 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|