C42H28F6N8O6 — CID 157226503
methyl 3-amino-5-[1-[6-(trifluoromethyl)-2-pyridinyl]indazol-6-yl]benzoate;methyl 3-nitro-5-[1-[6-(trifluoromethyl)-2-pyridinyl]indazol-6-yl]benzoate (PubChem CID 157226503) has the molecular formula C42H28F6N8O6 and a molecular weight of 854.72 g/mol. Its IUPAC name is methyl 3-amino-5-[1-[6-(trifluoromethyl)-2-pyridinyl]indazol-6-yl]benzoate;methyl 3-nitro-5-[1-[6-(trifluoromethyl)-2-pyridinyl]indazol-6-yl]benzoate.
| Compound Name | methyl 3-amino-5-[1-[6-(trifluoromethyl)-2-pyridinyl]indazol-6-yl]benzoate;methyl 3-nitro-5-[1-[6-(trifluoromethyl)-2-pyridinyl]indazol-6-yl]benzoate |
|---|---|
| PubChem CID | 157226503 |
| Molecular Formula | C42H28F6N8O6 |
| Molecular Weight | 854.72 g/mol |
| Exact Mass | 854.20 |
| IUPAC Name | methyl 3-amino-5-[1-[6-(trifluoromethyl)-2-pyridinyl]indazol-6-yl]benzoate;methyl 3-nitro-5-[1-[6-(trifluoromethyl)-2-pyridinyl]indazol-6-yl]benzoate |
| SMILES | COC(=O)c1cc(-c2ccc3cnn(-c4cccc(C(F)(F)F)n4)c3c2)cc([N+](=O)[O-])c1.COC(=O)c1cc(N)cc(-c2ccc3cnn(-c4cccc(C(F)(F)F)n4)c3c2)c1 |
| InChI | InChI=1S/C21H13F3N4O4.C21H15F3N4O2/c1-32-20(29)15-7-14(8-16(9-15)28(30)31)12-5-6-13-11-25-27(17(13)10-12)19-4-2-3-18(26-19)21(22,23)24;1-30-20(29)15-7-14(8-16(25)9-15)12-5-6-13-11-26-28(17(13)10-12)19-4-2-3-18(27-19)21(22,23)24/h2-11H,1H3;2-11H,25H2,1H3 |
| InChIKey | ATPDUJYQSAWWMT-UHFFFAOYSA-N |
| XLogP | 9.28 |
| TPSA | 183.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 62 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 854.72 |
| LogP ≤ 5 | 9.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|