C24H7F8N5O2 — CID 157226711
4,6-difluoro-2-[4-(4-fluoro-6-methyl-1,3-benzoxazol-2-yl)-6-(2,3,4,5,6-pentafluorophenyl)-1,3,5-triazin-2-yl]-1,3-benzoxazole (PubChem CID 157226711) has the molecular formula C24H7F8N5O2 and a molecular weight of 549.34 g/mol. Its IUPAC name is 4,6-difluoro-2-[4-(4-fluoro-6-methyl-1,3-benzoxazol-2-yl)-6-(2,3,4,5,6-pentafluorophenyl)-1,3,5-triazin-2-yl]-1,3-benzoxazole.
| Compound Name | 4,6-difluoro-2-[4-(4-fluoro-6-methyl-1,3-benzoxazol-2-yl)-6-(2,3,4,5,6-pentafluorophenyl)-1,3,5-triazin-2-yl]-1,3-benzoxazole |
|---|---|
| PubChem CID | 157226711 |
| Molecular Formula | C24H7F8N5O2 |
| Molecular Weight | 549.34 g/mol |
| Exact Mass | 549.05 |
| IUPAC Name | 4,6-difluoro-2-[4-(4-fluoro-6-methyl-1,3-benzoxazol-2-yl)-6-(2,3,4,5,6-pentafluorophenyl)-1,3,5-triazin-2-yl]-1,3-benzoxazole |
| SMILES | Cc1cc(F)c2nc(-c3nc(-c4nc5c(F)cc(F)cc5o4)nc(-c4c(F)c(F)c(F)c(F)c4F)n3)oc2c1 |
| InChI | InChI=1S/C24H7F8N5O2/c1-6-2-8(26)18-10(3-6)38-23(33-18)21-35-20(12-13(28)15(30)17(32)16(31)14(12)29)36-22(37-21)24-34-19-9(27)4-7(25)5-11(19)39-24/h2-5H,1H3 |
| InChIKey | XYQUQGDPDUBBCJ-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 90.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.34 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|