C25H38ClN3O10P2 — CID 157226755
[6-[(7-chloroquinolin-4-yl)-[5-[ethyl(2-hydroxyethyl)amino]pentan-2-yl]carbamoyl]oxy-3-oxo-1-phosphonohexyl]phosphonic acid (PubChem CID 157226755) has the molecular formula C25H38ClN3O10P2 and a molecular weight of 637.99 g/mol. Its IUPAC name is [6-[(7-chloroquinolin-4-yl)-[5-[ethyl(2-hydroxyethyl)amino]pentan-2-yl]carbamoyl]oxy-3-oxo-1-phosphonohexyl]phosphonic acid.
| Compound Name | [6-[(7-chloroquinolin-4-yl)-[5-[ethyl(2-hydroxyethyl)amino]pentan-2-yl]carbamoyl]oxy-3-oxo-1-phosphonohexyl]phosphonic acid |
|---|---|
| PubChem CID | 157226755 |
| Molecular Formula | C25H38ClN3O10P2 |
| Molecular Weight | 637.99 g/mol |
| Exact Mass | 637.17 |
| IUPAC Name | [6-[(7-chloroquinolin-4-yl)-[5-[ethyl(2-hydroxyethyl)amino]pentan-2-yl]carbamoyl]oxy-3-oxo-1-phosphonohexyl]phosphonic acid |
| SMILES | CCN(CCO)CCCC(C)N(C(=O)OCCCC(=O)CC(P(=O)(O)O)P(=O)(O)O)c1ccnc2cc(Cl)ccc12 |
| InChI | InChI=1S/C25H38ClN3O10P2/c1-3-28(13-14-30)12-4-6-18(2)29(23-10-11-27-22-16-19(26)8-9-21(22)23)25(32)39-15-5-7-20(31)17-24(40(33,34)35)41(36,37)38/h8-11,16,18,24,30H,3-7,12-15,17H2,1-2H3,(H2,33,34,35)(H2,36,37,38) |
| InChIKey | MTQOPZYWBABNGL-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 198.03 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.99 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|